(1-{2-[(4R,6S)-8-Chloro-6-(2,3-dimethoxy-phenyl)-1-isopropyl-4H,6H-2,5-dioxa-3-aza-benzo[e]azulen-4-yl]-acetyl}-piperidin-4-yl)-acetic acid

ID: ALA1778342

PubChem CID: 54582703

Max Phase: Preclinical

Molecular Formula: C31H35ClN2O7

Molecular Weight: 583.08

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  COc1cccc([C@H]2O[C@H](CC(=O)N3CCC(CC(=O)O)CC3)c3noc(C(C)C)c3-c3ccc(Cl)cc32)c1OC

Standard InChI:  InChI=1S/C31H35ClN2O7/c1-17(2)29-27-20-9-8-19(32)15-22(20)30(21-6-5-7-23(38-3)31(21)39-4)40-24(28(27)33-41-29)16-25(35)34-12-10-18(11-13-34)14-26(36)37/h5-9,15,17-18,24,30H,10-14,16H2,1-4H3,(H,36,37)/t24-,30-/m1/s1

Standard InChI Key:  YQGPZWOFUCOMGM-AYWVHJORSA-N

Molfile:  

     RDKit          2D

 41 45  0  0  0  0  0  0  0  0999 V2000
    3.2402   -6.9468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2391   -7.7337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9190   -8.1264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9173   -6.5543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4272   -7.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0245   -6.5638    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2274   -6.4286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6027   -7.7359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5976   -6.9434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2805   -7.2887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6830   -6.5357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5363   -6.5078    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2321   -5.8107    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0829   -8.0753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2804   -8.2666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2144   -9.0890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9762   -9.4059    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5129   -8.7794    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5103   -9.5190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7859   -9.1242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5307  -10.3438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5606   -6.5547    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    5.0269   -5.6745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5852   -5.1217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3851   -4.3638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6271   -4.1576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0694   -4.7153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2725   -5.4711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3423   -5.3280    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8994   -4.7755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9420   -3.8110    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6991   -4.0169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9851   -7.2341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8347   -7.2084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2413   -6.4572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7916   -5.7302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9354   -5.7544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0950   -6.4325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5433   -7.1595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3971   -7.1347    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.1378   -7.9112    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  8  9  1  0
 19 20  1  0
  9  7  1  0
 19 21  1  0
  4  1  1  0
  1 22  1  0
  5 10  1  6
 23 24  2  0
 10 11  1  0
 24 25  1  0
  2  3  1  0
 25 26  2  0
 11 12  1  0
 26 27  1  0
  3  8  2  0
 27 28  2  0
 28 23  1  0
  7 23  1  1
 11 13  2  0
 24 29  1  0
 14 15  1  0
 29 30  1  0
  1  2  2  0
 25 31  1  0
  9  4  2  0
 31 32  1  0
 12 33  1  0
  5  6  1  0
  6  7  1  0
  5 14  1  0
 15 16  2  0
 16 17  1  0
 12 37  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 17 18  1  0
 35 38  1  0
 18 14  2  0
 38 39  1  0
 15  8  1  0
 39 40  1  0
 16 19  1  0
 39 41  2  0
M  END

Alternative Forms

1. Parent:

   

   ALA1778342

   (1-{2-[(4R,6S)-8-Chloro-6-(2,3-dimethoxy-phenyl)-1-isopropyl-4H,6H-2,5-dioxa-3-aza-benzo[e]azulen-4-yl]-acetyl}-piperidin-4-yl)-acetic acid

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 583.08

Molecular Weight (Monoisotopic): 582.2133

AlogP: 6.40

#Rotatable Bonds: 8

Polar Surface Area: 111.33

Molecular Species: ACID

HBA: 7

HBD: 1

#RO5 Violations: 2

HBA (Lipinski): 9

HBD (Lipinski): 1

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 4.04

CX Basic pKa: ┄

CX LogP: 4.68

CX LogD: 1.55

Aromatic Rings: 3

Heavy Atoms: 41

QED Weighted: 0.32

Np Likeness Score: -0.39

References

1. Griebenow N, Buchmueller A, Kolkhof P, Schamberger J, Bischoff H..  (2011)  Identification of 4H,6H-[2]benzoxepino[4,5-c][1,2]oxazoles as novel squalene synthase inhibitors.,  21  (12): [PMID:21576018] [10.1016/j.bmcl.2011.04.092]

Source

Source(1):

• Scientific Literature