The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((5-methyl-2-phenyloxazol-4-yl)methyl)-N-((6-methylpyridin-2-yl)methyl)-1,2,3,4-tetrahydroisoquinoline-4-carboxamide ID: ALA1779976
PubChem CID: 54587529
Max Phase: Preclinical
Molecular Formula: C28H28N4O2
Molecular Weight: 452.56
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cccc(CNC(=O)C2CN(Cc3nc(-c4ccccc4)oc3C)Cc3ccccc32)n1
Standard InChI: InChI=1S/C28H28N4O2/c1-19-9-8-13-23(30-19)15-29-27(33)25-17-32(16-22-12-6-7-14-24(22)25)18-26-20(2)34-28(31-26)21-10-4-3-5-11-21/h3-14,25H,15-18H2,1-2H3,(H,29,33)
Standard InChI Key: KTZOPPLFULGANJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
4.8422 1.5029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6655 1.5018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0763 2.2131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6650 2.9259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8386 2.9231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4314 2.2113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9014 2.2129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3907 1.5459 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1755 1.8007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1757 2.6257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3911 2.8809 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8433 3.1106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5969 2.7747 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5897 1.9448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2976 1.5279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3119 3.1800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0242 2.7584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0154 1.9354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7227 1.5181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4393 1.9226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4441 2.7488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7362 3.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2910 0.7028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8429 1.3156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5731 0.2960 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.0022 0.2846 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8619 0.7142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1441 0.3073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4350 0.7293 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7176 0.3231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7106 -0.5028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4269 -0.9209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1413 -0.5124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0066 0.7418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15 18 1 0
17 16 1 0
3 4 2 0
8 9 1 0
17 18 2 0
18 19 1 0
4 5 1 0
19 20 2 0
2 3 1 0
20 21 1 0
7 8 1 0
21 22 2 0
22 17 1 0
9 10 2 0
15 23 1 0
11 7 2 0
9 24 1 0
5 6 2 0
23 25 1 0
10 12 1 0
23 26 2 0
6 1 1 0
25 27 1 0
12 13 1 0
27 28 1 0
13 14 1 0
28 29 2 0
1 2 2 0
29 30 1 0
3 7 1 0
30 31 2 0
10 11 1 0
31 32 1 0
13 16 1 0
32 33 2 0
33 28 1 0
14 15 1 0
30 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 452.56Molecular Weight (Monoisotopic): 452.2212AlogP: 4.77#Rotatable Bonds: 6Polar Surface Area: 71.26Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.40CX Basic pKa: 6.99CX LogP: 3.44CX LogD: 3.30Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.46Np Likeness Score: -1.65
References 1. DeNinno MP, Wright SW, Visser MS, Etienne JB, Moore DE, Olson TV, Rocke BN, Andrews MP, Zarbo C, Millham ML, Boscoe BP, Boyer DD, Doran SD, Houseknecht KL.. (2011) 1,5-Substituted nipecotic amides: selective PDE8 inhibitors displaying diastereomer-dependent microsomal stability., 21 (10): [PMID:21459572 ] [10.1016/j.bmcl.2011.03.022 ]