Standard InChI: InChI=1S/C24H26N6/c25-19-28-24(21-9-12-26-13-10-21)27-11-4-14-29-15-17-30(18-16-29)23-8-3-6-20-5-1-2-7-22(20)23/h1-3,5-10,12-13H,4,11,14-18H2,(H,27,28)
1.Fiorino F, Magli E, Perissutti E, Severino B, Frecentese F, Esposito A, De Angelis F, Incisivo GM, Massarelli P, Nencini C, Di Gennaro E, Budillon A, Di Cintio A, Santagada V, Caliendo G.. (2011) Synthesis of 1-naphtylpiperazine derivatives as serotoninergic ligands and their evaluation as antiproliferative agents., 46 (6):[PMID:21440338][10.1016/j.ejmech.2011.03.001]