The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Turnagainolide A ID: ALA1784527
PubChem CID: 53355936
Max Phase: Preclinical
Molecular Formula: C30H44N4O6
Molecular Weight: 556.70
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Synonyms: Turnagainolide A | Turnagainolide A|CHEBI:67522|CHEMBL1784527|BDBM50499937|Q27135990
Canonical SMILES: CC[C@H](C)[C@@H]1NC(=O)[C@@H](C)NC(=O)[C@H](C(C)C)NC(=O)C[C@H](/C=C/c2ccccc2)OC(=O)[C@H](C(C)C)NC1=O
Standard InChI: InChI=1S/C30H44N4O6/c1-8-19(6)26-29(38)33-25(18(4)5)30(39)40-22(15-14-21-12-10-9-11-13-21)16-23(35)32-24(17(2)3)28(37)31-20(7)27(36)34-26/h9-15,17-20,22,24-26H,8,16H2,1-7H3,(H,31,37)(H,32,35)(H,33,38)(H,34,36)/b15-14+/t19-,20+,22-,24-,25-,26-/m0/s1
Standard InChI Key: SMWGFJCKWZCJNQ-VTKBYMJVSA-N
Molfile:
RDKit 2D
41 42 0 0 0 0 0 0 0 0999 V2000
-2.2350 -0.1485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2350 -0.9900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5112 -1.4085 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7791 -0.9900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6726 -0.1485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6726 -0.9900 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0553 -1.4085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5098 1.0354 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7853 1.4489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0579 1.0354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2237 1.4553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9386 1.0440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9472 0.2670 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6599 1.4585 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3788 1.0507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3931 0.2669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7861 2.2739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0719 2.6870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5009 2.6858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2198 2.2803 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5196 0.2624 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.9496 -1.4023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7770 -0.1650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0564 -2.2335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7713 -2.6451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6576 -2.6469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0879 1.4724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8076 1.0691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5167 1.4908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2352 1.0850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9439 1.5060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9337 2.3318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2089 2.7348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5033 2.3115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6504 1.4611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3675 1.0531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0793 1.4702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6452 2.2861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9458 1.8708 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.0515 0.2105 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2980 0.3520 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5 6 1 0
1 21 2 0
6 7 1 0
2 22 1 6
7 4 1 0
4 23 2 0
8 9 1 0
7 24 1 1
9 10 1 0
24 25 1 0
11 12 1 0
24 26 1 0
8 11 1 0
15 27 1 1
1 13 1 0
27 28 2 0
12 13 1 0
28 29 1 0
14 15 1 0
29 30 2 0
10 14 1 0
30 31 1 0
5 16 1 0
31 32 2 0
15 16 1 0
32 33 1 0
33 34 2 0
34 29 1 0
9 17 1 1
12 35 1 0
1 2 1 0
35 36 1 0
17 18 1 0
36 37 1 0
2 3 1 0
35 38 1 6
17 19 1 0
12 39 1 6
3 4 1 0
10 40 2 0
11 20 2 0
5 41 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 556.70Molecular Weight (Monoisotopic): 556.3261AlogP: 2.33#Rotatable Bonds: 6Polar Surface Area: 142.70Molecular Species: NEUTRALHBA: 6HBD: 4#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.65CX Basic pKa: ┄CX LogP: 3.22CX LogD: 3.22Aromatic Rings: 1Heavy Atoms: 40QED Weighted: 0.40Np Likeness Score: 1.66
References 1. Li D, Carr G, Zhang Y, Williams DE, Amlani A, Bottriell H, Mui AL, Andersen RJ.. (2011) Turnagainolides A and B, cyclic depsipeptides produced in culture by a Bacillus sp.: isolation, structure elucidation, and synthesis., 74 (5): [PMID:21539394 ] [10.1021/np200033y ] 2. Igarashi Y, Yamamoto K, Fukuda T, Shojima A, Nakayama J, Carro L, Trujillo ME.. (2015) Arthroamide, a Cyclic Depsipeptide with Quorum Sensing Inhibitory Activity from Arthrobacter sp., 78 (11): [PMID:26575343 ] [10.1021/acs.jnatprod.5b00540 ]