The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-({6-[Methyl-(2-methyl-4-oxo-3,4-dihydro-quinazolin-6-ylmethyl)-amino]-pyridine-3-carbonyl}-amino)-pentanedioic acid;monosodium salt ID: ALA1788164
PubChem CID: 136130202
Max Phase: Preclinical
Molecular Formula: C22H22N5NaO6
Molecular Weight: 453.46
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nc2ccc(CN(C)c3ccc(C(=O)N[C@@H](CCC(=O)[O-])C(=O)O)cn3)cc2c(=O)[nH]1.[Na+]
Standard InChI: InChI=1S/C22H23N5O6.Na/c1-12-24-16-5-3-13(9-15(16)21(31)25-12)11-27(2)18-7-4-14(10-23-18)20(30)26-17(22(32)33)6-8-19(28)29;/h3-5,7,9-10,17H,6,8,11H2,1-2H3,(H,26,30)(H,28,29)(H,32,33)(H,24,25,31);/q;+1/p-1/t17-;/m0./s1
Standard InChI Key: GVXLJMJARFTARX-LMOVPXPDSA-M
Molfile:
RDKit 2D
34 35 0 0 0 0 0 0 0 0999 V2000
-5.1464 -3.9751 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.1464 -4.8001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4344 -5.2084 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.4344 -3.5584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4344 -2.7334 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.7224 -3.9751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7240 -4.7982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0131 -5.2094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3000 -4.7986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3024 -3.9723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0139 -3.5648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5892 -3.5575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8735 -3.9677 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.1603 -3.5529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5569 -3.9655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2695 -3.5514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2673 -2.7256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5465 -2.3155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1632 -2.7320 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9799 -2.3098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9762 -1.4848 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6927 -2.7165 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4051 -2.3004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1216 -2.7093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4009 -1.4754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1130 -1.0589 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6841 -1.0661 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8340 -2.2932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5505 -2.7021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5556 -3.5284 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2639 -2.2873 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.8603 -5.2136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8708 -4.7927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8616 -0.5009 0.0000 Na 0 0 0 0 0 15 0 0 0 0 0 0
15 16 1 0
7 8 1 0
16 17 2 0
3 7 1 0
17 18 1 0
8 9 2 0
18 19 2 0
19 14 1 0
6 4 1 0
17 20 1 0
9 10 1 0
20 21 2 0
20 22 1 0
10 11 2 0
22 23 1 0
11 6 1 0
23 24 1 6
4 5 2 0
23 25 1 0
10 12 1 0
1 2 1 0
25 26 1 0
25 27 2 0
12 13 1 0
24 28 1 0
1 4 1 0
28 29 1 0
13 14 1 0
6 7 2 0
29 30 1 0
29 31 2 0
14 15 2 0
2 32 1 0
2 3 2 0
13 33 1 0
M CHG 2 30 -1 34 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 453.46Molecular Weight (Monoisotopic): 453.1648AlogP: 1.31#Rotatable Bonds: 9Polar Surface Area: 165.58Molecular Species: ACIDHBA: 7HBD: 4#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 2.91CX Basic pKa: 6.10CX LogP: -1.41CX LogD: -4.64Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.37Np Likeness Score: -1.17
References 1. Marsham PR, Hughes LR, Jackman AL, Hayter AJ, Oldfield J, Wardleworth JM, Bishop JA, O'Connor BM, Calvert AH.. (1991) Quinazoline antifolate thymidylate synthase inhibitors: heterocyclic benzoyl ring modifications., 34 (5): [PMID:2033585 ] [10.1021/jm00109a011 ]