The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Amino-4-{2-[5-(6-amino-purin-9-yl)-3,4-dihydroxy-tetrahydro-furan-2-yl]-4-phosphonoHydroxyphosphinoylamino-phosphonic acid-propylsulfanyl}-butyric acid ID: ALA1791425
PubChem CID: 56681596
Max Phase: Preclinical
Molecular Formula: C16H28N7O14P3S
Molecular Weight: 667.42
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Nc1ncnc2c1ncn2[C@@H]1O[C@H](C(CCOP(=O)(O)OP(=O)(O)NP(=O)(O)O)SCCC(N)C(=O)O)[C@@H](O)[C@H]1O
Standard InChI: InChI=1S/C16H28N7O14P3S/c17-7(16(26)27)2-4-41-8(1-3-35-40(33,34)37-39(31,32)22-38(28,29)30)12-10(24)11(25)15(36-12)23-6-21-9-13(18)19-5-20-14(9)23/h5-8,10-12,15,24-25H,1-4,17H2,(H,26,27)(H,33,34)(H2,18,19,20)(H4,22,28,29,30,31,32)/t7?,8?,10-,11+,12+,15+/m0/s1
Standard InChI Key: GHWMOABBQNXILH-GQGKXLRMSA-N
Molfile:
RDKit 2D
41 43 0 0 0 0 0 0 0 0999 V2000
7.3612 -7.7810 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2908 -6.9590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4213 -0.8960 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
8.0676 -8.2072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8805 -9.0107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0585 -9.0811 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9145 -6.4189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5845 -6.5328 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6914 -0.1165 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7376 -8.3211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1513 -1.6756 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7715 -5.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5935 -5.6589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1513 0.5072 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
5.6914 -2.2992 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
8.4828 -9.5745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8570 -7.9675 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2722 -9.3347 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7209 -4.3261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2009 -1.1661 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4593 -8.5312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6112 1.1308 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3150 -1.7591 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2315 -5.1056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6418 -0.6260 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4508 -5.1056 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7180 -6.6060 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5310 -4.1701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2315 -2.9229 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7749 1.0473 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5276 -0.0329 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0677 -2.8393 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0198 -4.9525 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2957 -10.3780 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4213 -5.2615 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.1808 -3.7024 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5015 -4.3261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8011 -3.3906 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0711 -4.7938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8812 -4.6379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9614 -3.7024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 6
3 11 1 0
4 1 1 0
5 4 2 0
6 10 2 0
7 2 1 0
2 8 1 0
9 3 1 0
10 1 1 0
11 15 1 0
12 8 1 0
7 13 1 0
14 9 1 0
15 29 1 0
16 5 1 0
17 4 1 0
18 21 1 0
19 28 1 0
20 3 2 0
21 17 2 0
22 14 2 0
23 15 2 0
12 24 1 6
25 3 1 0
26 19 2 0
7 27 1 1
28 39 1 0
29 41 1 0
30 14 1 0
31 14 1 0
32 15 1 0
13 33 1 1
34 16 1 0
35 24 1 0
36 19 1 0
37 24 1 0
38 28 1 0
39 40 1 0
40 35 1 0
41 37 1 0
6 5 1 0
13 12 1 0
18 16 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 667.42Molecular Weight (Monoisotopic): 667.0628AlogP: -1.76#Rotatable Bonds: 15Polar Surface Area: 345.25Molecular Species: ZWITTERIONHBA: 16HBD: 10#RO5 Violations: 3HBA (Lipinski): 21HBD (Lipinski): 12#RO5 Violations (Lipinski): 3CX Acidic pKa: 0.36CX Basic pKa: 9.50CX LogP: -7.96CX LogD: -15.11Aromatic Rings: 2Heavy Atoms: 41QED Weighted: 0.09Np Likeness Score: 1.00
References 1. Kappler F, Vrudhula VM, Hampton A.. (1988) Toward the synthesis of isozyme-specific enzyme inhibitors. Potent inhibitors of rat methionine adenosyltransferases. Effect of one-atom elongation of the ribose-P alpha bridge in two covalent adducts of L-methionine and beta,gamma-imido-ATP., 31 (2): [PMID:3257524 ] [10.1021/jm00397a020 ]