The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID17413473 ID: ALA1794141
PubChem CID: 2918492
Max Phase: Preclinical
Molecular Formula: C23H18F3N3O6
Molecular Weight: 489.41
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(C(=O)C2C(c3ccc(-c4ccccc4[N+](=O)[O-])o3)NC(=O)NC2(O)C(F)(F)F)cc1
Standard InChI: InChI=1S/C23H18F3N3O6/c1-12-6-8-13(9-7-12)20(30)18-19(27-21(31)28-22(18,32)23(24,25)26)17-11-10-16(35-17)14-4-2-3-5-15(14)29(33)34/h2-11,18-19,32H,1H3,(H2,27,28,31)
Standard InChI Key: QROPNDQWOQPCBZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
-0.0684 -3.1883 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.4972 -2.1679 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.0889 -2.6227 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.2647 -1.9639 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.9026 1.2710 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3136 -0.3536 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4533 -0.6761 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.7134 2.9934 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.9990 1.7559 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2972 -1.5160 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1479 -0.0949 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.9990 2.5809 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5232 -1.6022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0082 -0.9348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6726 -0.1811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2958 -2.3953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8286 -1.0210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1575 0.4863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6328 -0.7623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1642 -1.7747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5700 1.7559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9825 0.4863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5700 2.5809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2375 1.2710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6793 -2.4421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9847 -1.8609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2845 2.9934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8556 2.9934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0148 -3.1958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3202 -2.6146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8353 -3.2820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2845 3.8184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8556 3.8184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5700 4.2309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1709 -4.0357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 16 1 0
2 16 1 0
3 16 1 0
4 13 1 0
5 18 1 0
5 21 1 0
6 17 2 0
7 19 2 0
8 12 1 0
9 12 2 0
10 13 1 0
10 19 1 0
11 15 1 0
11 19 1 0
12 27 1 0
13 14 1 0
13 16 1 0
14 15 1 0
14 17 1 0
15 18 1 0
17 20 1 0
18 22 2 0
20 25 2 0
20 26 1 0
21 23 1 0
21 24 2 0
22 24 1 0
23 27 1 0
23 28 2 0
25 29 1 0
26 30 2 0
27 32 2 0
28 33 1 0
29 31 2 0
30 31 1 0
31 35 1 0
32 34 1 0
33 34 2 0
M CHG 2 8 -1 12 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 489.41Molecular Weight (Monoisotopic): 489.1148AlogP: 4.27#Rotatable Bonds: 5Polar Surface Area: 134.71Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.16CX Basic pKa: ┄CX LogP: 4.02CX LogD: 4.02Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.28Np Likeness Score: -0.94
References 1. PubChem BioAssay data set,