The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-{2-[2-(2-Chloro-phenyl)-2-hydroxy-ethylamino]-ethyl}-2-phenyl-acetamide; Fumarate ID: ALA1794836
PubChem CID: 22769501
Max Phase: Preclinical
Molecular Formula: C22H25ClN2O6
Molecular Weight: 332.83
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Cc1ccccc1)NCCNCC(O)c1ccccc1Cl.O=C(O)/C=C/C(=O)O
Standard InChI: InChI=1S/C18H21ClN2O2.C4H4O4/c19-16-9-5-4-8-15(16)17(22)13-20-10-11-21-18(23)12-14-6-2-1-3-7-14;5-3(6)1-2-4(7)8/h1-9,17,20,22H,10-13H2,(H,21,23);1-2H,(H,5,6)(H,7,8)/b;2-1+
Standard InChI Key: FFTZGZLUQCRAAJ-WLHGVMLRSA-N
Molfile:
RDKit 2D
31 31 0 0 0 0 0 0 0 0999 V2000
-9.8482 -0.3249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8482 0.1126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.5607 0.0876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8482 0.9376 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-9.1357 0.0918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.5607 -0.3082 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.1357 -0.2999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.5649 0.9126 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-7.7024 0.1001 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.4149 0.1126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.1357 0.9168 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-9.8482 -1.1499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.4232 -0.3124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.2732 -0.3249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2732 0.1043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.9857 -0.3124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7024 -0.2999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4232 0.9376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.5607 -1.5624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.2732 -1.1499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7149 1.3501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9899 0.1168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9982 0.9418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.8777 0.3020 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-14.7027 0.3020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-15.1152 1.0164 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-15.1152 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-15.9402 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-16.3527 -1.1270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-15.9402 -1.8414 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-17.1777 -1.1270 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 6 1 0
3 1 2 0
4 2 2 0
5 1 1 0
6 15 1 0
7 2 1 0
8 3 1 0
9 13 1 0
10 7 1 0
11 5 1 0
12 1 1 0
13 5 1 0
14 3 1 0
15 16 1 0
16 9 1 0
17 10 2 0
18 10 1 0
19 12 2 0
20 19 1 0
21 18 2 0
22 17 1 0
23 21 1 0
20 14 2 0
23 22 2 0
24 25 1 0
25 26 2 0
25 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
29 31 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 332.83Molecular Weight (Monoisotopic): 332.1292AlogP: 2.32#Rotatable Bonds: 8Polar Surface Area: 61.36Molecular Species: BASEHBA: 3HBD: 3#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.89CX Basic pKa: 8.58CX LogP: 2.36CX LogD: 1.15Aromatic Rings: 2Heavy Atoms: 23QED Weighted: 0.65Np Likeness Score: -0.94
References 1. Large MS, Smith LH.. (1980) Beta-adrenergic blocking agents. 19. 1-Phenyl-2-[[(substituted-amido)alkyl]amino]ethanols., 23 (2): [PMID:6102152 ] [10.1021/jm00176a002 ]