The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-({[(S)-2-((R)-3-Hydroxy-pyrrolidin-1-yl)-1-phenyl-ethyl]-methyl-carbamoyl}-methyl)-2-methoxy-benzamide ID: ALA179627
PubChem CID: 44389964
Max Phase: Preclinical
Molecular Formula: C23H29N3O4
Molecular Weight: 411.50
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccccc1C(=O)NCC(=O)N(C)[C@H](CN1CC[C@@H](O)C1)c1ccccc1
Standard InChI: InChI=1S/C23H29N3O4/c1-25(22(28)14-24-23(29)19-10-6-7-11-21(19)30-2)20(17-8-4-3-5-9-17)16-26-13-12-18(27)15-26/h3-11,18,20,27H,12-16H2,1-2H3,(H,24,29)/t18-,20-/m1/s1
Standard InChI Key: PXPJOAVITOEIEW-UYAOXDASSA-N
Molfile:
RDKit 2D
30 32 0 0 1 0 0 0 0 0999 V2000
-2.7833 -0.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7917 -0.7792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.0625 -0.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5042 -0.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9375 -0.3667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0750 -0.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3583 -0.3667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2167 -0.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6458 -0.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4958 -0.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0625 -1.6042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0750 0.4583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5042 0.4583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7000 0.4208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7542 -0.3875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0375 0.3958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3792 0.8958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7833 0.4583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4958 -1.6042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7917 -1.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4000 1.7208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.2083 -0.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7917 0.8708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2167 0.8708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2083 -2.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4958 0.8708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2167 1.7083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2083 0.4583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7917 1.7083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5042 2.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 6 1 0
3 1 1 0
4 2 1 0
5 8 1 0
6 9 1 0
7 3 1 0
8 4 1 0
9 7 1 0
10 1 1 0
11 3 2 0
12 6 2 0
4 13 1 1
14 5 1 0
15 5 1 0
16 15 1 0
17 14 1 0
18 1 2 0
19 10 1 0
20 2 1 0
17 21 1 6
22 10 2 0
23 13 1 0
24 13 2 0
25 19 1 0
26 18 1 0
27 24 1 0
28 26 2 0
29 23 2 0
30 27 2 0
28 22 1 0
30 29 1 0
16 17 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 411.50Molecular Weight (Monoisotopic): 411.2158AlogP: 1.69#Rotatable Bonds: 8Polar Surface Area: 82.11Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.17CX LogP: 1.07CX LogD: 0.23Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.69Np Likeness Score: -1.01
References 1. Kumar V, Guo D, Daubert JD, Cassel JA, DeHaven RN, Mansson E, DeHaven-Hudkins DL, Maycock AL.. (2005) Amino acid conjugates as kappa opioid receptor agonists., 15 (5): [PMID:15713370 ] [10.1016/j.bmcl.2005.01.038 ]