4-(N-acetyl-N-(6,7,8,9-tetrahydrodibenzo[b,d]furan-2-yl)sulfamoyl)benzoate

ID: ALA1800272

Cas Number: 823828-19-9

PubChem CID: 2964738

Max Phase: Preclinical

Molecular Formula: C21H19NO6S

Molecular Weight: 413.45

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)N(c1ccc2oc3c(c2c1)CCCC3)S(=O)(=O)c1ccc(C(=O)O)cc1

Standard InChI:  InChI=1S/C21H19NO6S/c1-13(23)22(29(26,27)16-9-6-14(7-10-16)21(24)25)15-8-11-20-18(12-15)17-4-2-3-5-19(17)28-20/h6-12H,2-5H2,1H3,(H,24,25)

Standard InChI Key:  DQUKVRXAZRFLKT-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
    4.8856   -3.0170    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8897   -3.8410    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.6012   -3.4254    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6368   -3.1634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8102   -3.1826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4152   -3.9069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8458   -4.6126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6756   -4.5893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0669   -3.8644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5924   -3.9270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1634   -3.2232    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1982   -4.6509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3229   -4.5442    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9305   -5.2695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1466   -4.5210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1062   -5.2904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7138   -6.0147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3630   -5.9677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9744   -6.6926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1471   -6.7200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9175   -7.5152    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2569   -7.4701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6043   -7.9808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7197   -8.7968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4867   -9.1085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1393   -8.5978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0248   -7.7754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5784   -5.2227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5384   -3.7961    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  2  0
 13 15  1  0
 14 16  1  0
  2  1  2  0
 16 17  2  0
 17 20  1  0
  6 10  1  0
 19 18  1  0
 18 14  2  0
 19 20  2  0
 13 14  1  0
  6  7  2  0
 10 11  2  0
 20 21  1  0
 21 23  1  0
 22 19  1  0
 22 23  2  0
 10 12  1  0
  7  8  1  0
  9  2  1  0
  5  6  1  0
  2 13  1  0
  8  9  2  0
 22 27  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
  9  4  1  0
 15 28  1  0
  4  5  2  0
 15 29  2  0
M  END

Associated Targets(Human)

PTPN6 Tchem Protein-tyrosine phosphatase 1C (687 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PTPN1 Tchem Protein-tyrosine phosphatase 1B (8528 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PTPN11 Tchem Protein-tyrosine phosphatase 2C (2297 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 413.45Molecular Weight (Monoisotopic): 413.0933AlogP: 3.75#Rotatable Bonds: 4
Polar Surface Area: 104.89Molecular Species: ACIDHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 3.47CX Basic pKa: CX LogP: 3.48CX LogD: 0.10
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.70Np Likeness Score: -0.84

References

1. Yu ZH, Chen L, Wu L, Liu S, Wang L, Zhang ZY..  (2011)  Small molecule inhibitors of SHP2 tyrosine phosphatase discovered by virtual screening.,  21  (14): [PMID:21669525] [10.1016/j.bmcl.2011.05.078]

Source