3-{(4-Butoxy-benzenesulfonyl)-[2-(4-fluoro-phenyl)-ethyl]-amino}-3-(1H-imidazol-4-yl)-propionic acid

ID: ALA180029

PubChem CID: 44390088

Max Phase: Preclinical

Molecular Formula: C24H28FN3O5S

Molecular Weight: 489.57

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCOc1ccc(S(=O)(=O)N(CCc2ccc(F)cc2)C(CC(=O)O)c2c[nH]cn2)cc1

Standard InChI:  InChI=1S/C24H28FN3O5S/c1-2-3-14-33-20-8-10-21(11-9-20)34(31,32)28(13-12-18-4-6-19(25)7-5-18)23(15-24(29)30)22-16-26-17-27-22/h4-11,16-17,23H,2-3,12-15H2,1H3,(H,26,27)(H,29,30)

Standard InChI Key:  ARIXIUMAGVRJDS-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 36  0  0  0  0  0  0  0  0999 V2000
   -0.1333    1.1583    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8458    0.7458    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5583    1.1583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2708    0.7458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5583    1.9833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6375    0.7458    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5792    0.7458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4542    1.7458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7208    1.7458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8458   -0.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2750    2.3958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9583   -0.5417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6708   -0.0917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2333   -0.0917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2750    3.2208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2917    1.1583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5792   -0.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1333   -0.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1333   -2.9625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1333   -1.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0042   -0.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9833    1.9833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2917   -0.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0042    0.7458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1375   -3.7875    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8458   -2.5500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5792   -2.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5792   -1.7250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8458   -1.7250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7167   -0.5000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4292   -0.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1417   -0.4875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8542   -0.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5792   -0.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  3  1  0
  5  3  1  0
  6  4  1  0
  7  1  1  0
  8  1  2  0
  9  1  2  0
 10  2  1  0
 11  5  1  0
 12 14  1  0
 13  6  2  0
 14  4  2  0
 15 11  2  0
 16  7  1  0
 17  7  2  0
 18 10  1  0
 19 26  2  0
 20 18  1  0
 21 23  2  0
 22 11  1  0
 23 17  1  0
 24 16  2  0
 25 19  1  0
 26 29  1  0
 27 28  2  0
 28 20  1  0
 29 20  2  0
 30 21  1  0
 31 30  1  0
 32 31  1  0
 33 32  1  0
 34 33  1  0
 21 24  1  0
 13 12  1  0
 19 27  1  0
M  END

Associated Targets(Human)

FNTA Tclin Geranylgeranyl transferase type I (851 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 489.57Molecular Weight (Monoisotopic): 489.1734AlogP: 4.18#Rotatable Bonds: 13
Polar Surface Area: 112.59Molecular Species: ACIDHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 3.40CX Basic pKa: 6.17CX LogP: 2.67CX LogD: 1.47
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.35Np Likeness Score: -0.87

References

1. Saha AK, End DW..  (2005)  Novel beta-(imidazol-4-yl)-beta-amino acids: solid-phase synthesis and study of their inhibitory activity against geranylgeranyl protein transferase type I.,  15  (6): [PMID:15745827] [10.1016/j.bmcl.2005.01.042]

Source