The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-{(4-Butoxy-benzenesulfonyl)-[2-(4-fluoro-phenyl)-ethyl]-amino}-3-(1H-imidazol-4-yl)-propionic acid ID: ALA180029
PubChem CID: 44390088
Max Phase: Preclinical
Molecular Formula: C24H28FN3O5S
Molecular Weight: 489.57
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCOc1ccc(S(=O)(=O)N(CCc2ccc(F)cc2)C(CC(=O)O)c2c[nH]cn2)cc1
Standard InChI: InChI=1S/C24H28FN3O5S/c1-2-3-14-33-20-8-10-21(11-9-20)34(31,32)28(13-12-18-4-6-19(25)7-5-18)23(15-24(29)30)22-16-26-17-27-22/h4-11,16-17,23H,2-3,12-15H2,1H3,(H,26,27)(H,29,30)
Standard InChI Key: ARIXIUMAGVRJDS-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
-0.1333 1.1583 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.8458 0.7458 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.5583 1.1583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2708 0.7458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5583 1.9833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6375 0.7458 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.5792 0.7458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4542 1.7458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7208 1.7458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8458 -0.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2750 2.3958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9583 -0.5417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6708 -0.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2333 -0.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2750 3.2208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2917 1.1583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5792 -0.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1333 -0.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1333 -2.9625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1333 -1.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0042 -0.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9833 1.9833 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2917 -0.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0042 0.7458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1375 -3.7875 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.8458 -2.5500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5792 -2.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5792 -1.7250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8458 -1.7250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7167 -0.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4292 -0.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1417 -0.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8542 -0.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5792 -0.4667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 3 1 0
5 3 1 0
6 4 1 0
7 1 1 0
8 1 2 0
9 1 2 0
10 2 1 0
11 5 1 0
12 14 1 0
13 6 2 0
14 4 2 0
15 11 2 0
16 7 1 0
17 7 2 0
18 10 1 0
19 26 2 0
20 18 1 0
21 23 2 0
22 11 1 0
23 17 1 0
24 16 2 0
25 19 1 0
26 29 1 0
27 28 2 0
28 20 1 0
29 20 2 0
30 21 1 0
31 30 1 0
32 31 1 0
33 32 1 0
34 33 1 0
21 24 1 0
13 12 1 0
19 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 489.57Molecular Weight (Monoisotopic): 489.1734AlogP: 4.18#Rotatable Bonds: 13Polar Surface Area: 112.59Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.40CX Basic pKa: 6.17CX LogP: 2.67CX LogD: 1.47Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.35Np Likeness Score: -0.87
References 1. Saha AK, End DW.. (2005) Novel beta-(imidazol-4-yl)-beta-amino acids: solid-phase synthesis and study of their inhibitory activity against geranylgeranyl protein transferase type I., 15 (6): [PMID:15745827 ] [10.1016/j.bmcl.2005.01.042 ]