The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1E,6E)-1,7-Bis(3,4-dimethoxyphenyl)-4-(4-hydroxy-3-methoxybenzylidene)hepta-1,6-diene-3,5-dione ID: ALA1800965
Cas Number: 1227098-15-8
PubChem CID: 49851904
Product Number: N650195, Order Now?
Max Phase: Preclinical
Molecular Formula: C31H30O8
Molecular Weight: 530.57
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(C=C(C(=O)/C=C/c2ccc(OC)c(OC)c2)C(=O)/C=C/c2ccc(OC)c(OC)c2)ccc1O
Standard InChI: InChI=1S/C31H30O8/c1-35-27-14-9-20(17-30(27)38-4)6-11-24(32)23(16-22-8-13-26(34)29(19-22)37-3)25(33)12-7-21-10-15-28(36-2)31(18-21)39-5/h6-19,34H,1-5H3/b11-6+,12-7+
Standard InChI Key: AYIYVEPNEPUJCF-GNXRPPCSSA-N
Molfile:
RDKit 2D
39 41 0 0 0 0 0 0 0 0999 V2000
15.7652 -14.4541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7641 -15.2815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4789 -15.6944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1953 -15.2810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1925 -14.4505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4771 -14.0414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9054 -14.0353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6214 -14.4451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3343 -14.0299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0503 -14.4397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3312 -13.2049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.7633 -14.0245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4793 -14.4343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7601 -13.1995 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.1922 -14.0192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9082 -14.4290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9087 -15.2511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6238 -15.6608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3377 -15.2456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3320 -14.4163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6162 -14.0103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0507 -15.6934 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.0543 -15.6544 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3362 -15.2810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0541 -15.2628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6314 -15.9713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8062 -15.9578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3836 -16.6654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7858 -17.3867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6150 -17.3960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0339 -16.6877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0585 -16.4794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0507 -14.0418 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.0505 -13.2168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0434 -13.9986 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.7609 -14.4059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3641 -18.0958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.5587 -16.6532 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.1568 -15.9327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 5 1 0
19 20 1 0
9 10 1 0
20 21 2 0
21 16 1 0
2 3 1 0
2 22 1 0
9 11 2 0
19 23 1 0
5 6 2 0
22 24 1 0
10 12 1 0
10 25 2 0
6 1 1 0
25 26 1 0
12 13 1 0
26 27 2 0
1 2 2 0
27 28 1 0
12 14 2 0
28 29 2 0
5 7 1 0
29 30 1 0
13 15 2 0
30 31 2 0
31 26 1 0
3 4 2 0
23 32 1 0
15 16 1 0
1 33 1 0
7 8 2 0
33 34 1 0
16 17 2 0
20 35 1 0
35 36 1 0
17 18 1 0
29 37 1 0
8 9 1 0
28 38 1 0
18 19 2 0
38 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 530.57Molecular Weight (Monoisotopic): 530.1941AlogP: 5.38#Rotatable Bonds: 12Polar Surface Area: 100.52Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.99CX Basic pKa: ┄CX LogP: 6.01CX LogD: 6.00Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.19Np Likeness Score: 0.21
References 1. Qiu X, Du Y, Lou B, Zuo Y, Shao W, Huo Y, Huang J, Yu Y, Zhou B, Du J, Fu H, Bu X.. (2010) Synthesis and identification of new 4-arylidene curcumin analogues as potential anticancer agents targeting nuclear factor-κB signaling pathway., 53 (23): [PMID:21070043 ] [10.1021/jm1004545 ]