The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1E,6E)-1,7-Bis(3,4-dimethoxyphenyl)-4-(4-fluorobenzylidene)-hepta-1,6-diene-3,5-dione ID: ALA1800969
PubChem CID: 49851907
Max Phase: Preclinical
Molecular Formula: C30H27FO6
Molecular Weight: 502.54
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(/C=C/C(=O)C(=Cc2ccc(F)cc2)C(=O)/C=C/c2ccc(OC)c(OC)c2)cc1OC
Standard InChI: InChI=1S/C30H27FO6/c1-34-27-15-9-21(18-29(27)36-3)7-13-25(32)24(17-20-5-11-23(31)12-6-20)26(33)14-8-22-10-16-28(35-2)30(19-22)37-4/h5-19H,1-4H3/b13-7+,14-8+
Standard InChI Key: GQBAEKKKGLVJFA-FNCQTZNRSA-N
Molfile:
RDKit 2D
37 39 0 0 0 0 0 0 0 0999 V2000
4.0236 -25.0458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0224 -25.8732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7372 -26.2860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4537 -25.8727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4508 -25.0422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7354 -24.6330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1637 -24.6270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8797 -25.0368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5927 -24.6216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3087 -25.0314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5895 -23.7966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0216 -24.6162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7376 -25.0260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0185 -23.7912 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4505 -24.6108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1665 -25.0206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1670 -25.8428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8822 -26.2525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5961 -25.8372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5903 -25.0080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8745 -24.6020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3091 -26.2851 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3126 -26.2461 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5945 -25.8727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3124 -25.8544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8897 -26.5629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0645 -26.5494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6419 -27.2571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0442 -27.9784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8734 -27.9876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2923 -27.2793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3168 -27.0711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3090 -24.6335 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3088 -23.8085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3017 -24.5903 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0192 -24.9976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6224 -28.6874 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8 9 1 0
18 19 2 0
4 5 1 0
19 20 1 0
9 10 1 0
20 21 2 0
21 16 1 0
2 3 1 0
2 22 1 0
9 11 2 0
19 23 1 0
5 6 2 0
22 24 1 0
10 12 1 0
10 25 2 0
6 1 1 0
25 26 1 0
12 13 1 0
26 27 2 0
1 2 2 0
27 28 1 0
12 14 2 0
28 29 2 0
5 7 1 0
29 30 1 0
13 15 2 0
30 31 2 0
31 26 1 0
3 4 2 0
23 32 1 0
15 16 1 0
1 33 1 0
7 8 2 0
33 34 1 0
16 17 2 0
20 35 1 0
35 36 1 0
17 18 1 0
29 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 502.54Molecular Weight (Monoisotopic): 502.1792AlogP: 5.81#Rotatable Bonds: 11Polar Surface Area: 71.06Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.61CX LogD: 6.61Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.19Np Likeness Score: -0.22
References 1. Qiu X, Du Y, Lou B, Zuo Y, Shao W, Huo Y, Huang J, Yu Y, Zhou B, Du J, Fu H, Bu X.. (2010) Synthesis and identification of new 4-arylidene curcumin analogues as potential anticancer agents targeting nuclear factor-κB signaling pathway., 53 (23): [PMID:21070043 ] [10.1021/jm1004545 ]