The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-({4-[4-(1-Butyl-1H-1,2,3-triazole-4-yl)butoxy]-3-methoxyphenyl}-4-(2-methoxyphenyl)piperazine ID: ALA1803050
PubChem CID: 53363110
Max Phase: Preclinical
Molecular Formula: C29H41N5O3
Molecular Weight: 507.68
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCn1cc(CCCCOc2ccc(CN3CCN(c4ccccc4OC)CC3)cc2OC)nn1
Standard InChI: InChI=1S/C29H41N5O3/c1-4-5-15-34-23-25(30-31-34)10-8-9-20-37-28-14-13-24(21-29(28)36-3)22-32-16-18-33(19-17-32)26-11-6-7-12-27(26)35-2/h6-7,11-14,21,23H,4-5,8-10,15-20,22H2,1-3H3
Standard InChI Key: SVCSCOQWJKNMQT-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
20.0828 2.4478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0817 1.6206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7960 1.2077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5118 1.6210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5092 2.4512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7944 2.8605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7958 0.3827 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.0813 -0.0296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2270 1.2097 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.2234 0.3844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9344 -0.0269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6507 0.3833 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.6513 1.2092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9357 1.6251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3642 -0.0307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3625 -0.8558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6472 -1.2615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6451 -2.0858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3592 -2.5007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0770 -2.0853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0756 -1.2624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9295 -2.4964 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.2161 -2.0820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3585 -3.3257 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.0727 -3.7388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7874 -3.3269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5015 -3.7400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2164 -3.3281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9305 -3.7412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0175 -4.5603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8244 -4.7324 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.2376 -4.0183 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.6860 -3.4048 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.1593 -5.4864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9798 -5.5733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4653 -4.9063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2857 -4.9933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17 18 1 0
4 9 1 0
18 19 2 0
9 10 1 0
19 20 1 0
4 5 1 0
20 21 2 0
21 16 1 0
2 3 1 0
18 22 1 0
5 6 2 0
22 23 1 0
6 1 1 0
19 24 1 0
1 2 2 0
24 25 1 0
9 14 1 0
25 26 1 0
10 11 1 0
26 27 1 0
11 12 1 0
27 28 1 0
12 13 1 0
28 29 1 0
29 30 2 0
13 14 1 0
3 7 1 0
12 15 1 0
3 4 2 0
30 31 1 0
31 32 1 0
32 33 2 0
33 29 1 0
15 16 1 0
31 34 1 0
7 8 1 0
34 35 1 0
16 17 2 0
35 36 1 0
36 37 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 507.68Molecular Weight (Monoisotopic): 507.3209AlogP: 4.82#Rotatable Bonds: 14Polar Surface Area: 64.88Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.06CX LogP: 5.33CX LogD: 5.16Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.29Np Likeness Score: -1.43
References 1. Kühhorn J, Hübner H, Gmeiner P.. (2011) Bivalent dopamine D2 receptor ligands: synthesis and binding properties., 54 (13): [PMID:21599022 ] [10.1021/jm2004859 ]