The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-[(4-{3-[1-(2-Ethoxyethyl)-1H-1,2,3-triazole-4-yl]propoxy}-3-methoxyphenyl)methyl]-4-(2-methoxyphenyl)piperazine ID: ALA1803052
PubChem CID: 53363200
Max Phase: Preclinical
Molecular Formula: C28H39N5O4
Molecular Weight: 509.65
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCOCCn1cc(CCCOc2ccc(CN3CCN(c4ccccc4OC)CC3)cc2OC)nn1
Standard InChI: InChI=1S/C28H39N5O4/c1-4-36-19-17-33-22-24(29-30-33)8-7-18-37-27-12-11-23(20-28(27)35-3)21-31-13-15-32(16-14-31)25-9-5-6-10-26(25)34-2/h5-6,9-12,20,22H,4,7-8,13-19,21H2,1-3H3
Standard InChI Key: WFNJZMXOSUJROE-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
8.9609 -6.0436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9598 -6.8708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6742 -7.2836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3900 -6.8703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3873 -6.0402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6725 -5.6308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6740 -8.1087 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9594 -8.5210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1051 -7.2817 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.1015 -8.1070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8125 -8.5182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5288 -8.1081 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5294 -7.2821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8138 -6.8663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2424 -8.5221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2406 -9.3471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5253 -9.7529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5233 -10.5771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2374 -10.9920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9550 -10.5767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9537 -9.7538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8077 -10.9878 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0943 -10.5734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2366 -11.8171 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.9508 -12.2302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6656 -11.8183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3797 -12.2314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0946 -11.8194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8451 -12.1533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3977 -11.5407 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9857 -10.8258 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.1787 -10.9968 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.2181 -11.6276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5530 -12.3816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3734 -12.4685 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.7083 -13.2224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5287 -13.3094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17 18 1 0
4 9 1 0
18 19 2 0
9 10 1 0
19 20 1 0
4 5 1 0
20 21 2 0
21 16 1 0
2 3 1 0
18 22 1 0
5 6 2 0
22 23 1 0
6 1 1 0
19 24 1 0
1 2 2 0
24 25 1 0
9 14 1 0
25 26 1 0
10 11 1 0
26 27 1 0
11 12 1 0
27 28 1 0
28 29 2 0
12 13 1 0
13 14 1 0
3 7 1 0
12 15 1 0
29 30 1 0
30 31 1 0
31 32 2 0
32 28 1 0
3 4 2 0
30 33 1 0
15 16 1 0
33 34 1 0
7 8 1 0
34 35 1 0
16 17 2 0
35 36 1 0
36 37 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 509.65Molecular Weight (Monoisotopic): 509.3002AlogP: 3.67#Rotatable Bonds: 14Polar Surface Area: 74.11Molecular Species: NEUTRALHBA: 9HBD: ┄#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.06CX LogP: 3.87CX LogD: 3.71Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.30Np Likeness Score: -1.58
References 1. Kühhorn J, Hübner H, Gmeiner P.. (2011) Bivalent dopamine D2 receptor ligands: synthesis and binding properties., 54 (13): [PMID:21599022 ] [10.1021/jm2004859 ]