(E)-Ethyl 2-cyano-3-(6-fluoro-1H-indol-3-yl)acrylate

ID: ALA1812550

PubChem CID: 53391947

Max Phase: Preclinical

Molecular Formula: C14H11FN2O2

Molecular Weight: 258.25

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)/C(C#N)=C/c1c[nH]c2cc(F)ccc12

Standard InChI:  InChI=1S/C14H11FN2O2/c1-2-19-14(18)9(7-16)5-10-8-17-13-6-11(15)3-4-12(10)13/h3-6,8,17H,2H2,1H3/b9-5+

Standard InChI Key:  FEBZIDUDFVQQJL-WEVVVXLNSA-N

Molfile:  

     RDKit          2D

 19 20  0  0  0  0  0  0  0  0999 V2000
    8.8986    0.4375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8974   -0.3898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6122   -0.8027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6104    0.8503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3258    0.4412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3261   -0.3899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1165   -0.6465    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.6049    0.0260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1161    0.6982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3708    1.4829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1777    1.6546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4324    2.4393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1826   -0.8018    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   13.2393    2.6111    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8802    3.0523    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.7915    1.9982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5985    2.1700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7299    1.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2816    0.4294    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  9  5  1  0
  4  1  1  0
  9 10  1  0
  5  6  1  0
 10 11  2  0
 11 12  1  0
  2  3  1  0
  2 13  1  0
  3  6  2  0
 12 14  1  0
  1  2  2  0
 12 15  2  0
  5  4  2  0
 14 16  1  0
  6  7  1  0
 16 17  1  0
  7  8  1  0
 11 18  1  0
  8  9  2  0
 18 19  3  0
M  END

Associated Targets(non-human)

Tdo2 Tryptophan 2,3-dioxygenase (195 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 258.25Molecular Weight (Monoisotopic): 258.0805AlogP: 2.78#Rotatable Bonds: 3
Polar Surface Area: 65.88Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 2.93CX LogD: 2.93
Aromatic Rings: 2Heavy Atoms: 19QED Weighted: 0.52Np Likeness Score: -1.18

References

1. Dolusić E, Larrieu P, Moineaux L, Stroobant V, Pilotte L, Colau D, Pochet L, Van den Eynde B, Masereel B, Wouters J, Frédérick R..  (2011)  Tryptophan 2,3-dioxygenase (TDO) inhibitors. 3-(2-(pyridyl)ethenyl)indoles as potential anticancer immunomodulators.,  54  (15): [PMID:21726069] [10.1021/jm2006782]

Source