(E)-2-Cyano-3-(6-fluoro-1H-indol-3-yl)acrylic acid

ID: ALA1812551

PubChem CID: 53392057

Max Phase: Preclinical

Molecular Formula: C12H7FN2O2

Molecular Weight: 230.20

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  N#C/C(=C\c1c[nH]c2cc(F)ccc12)C(=O)O

Standard InChI:  InChI=1S/C12H7FN2O2/c13-9-1-2-10-8(6-15-11(10)4-9)3-7(5-14)12(16)17/h1-4,6,15H,(H,16,17)/b7-3+

Standard InChI Key:  JONAYMMCHYGONJ-XVNBXDOJSA-N

Molfile:  

     RDKit          2D

 17 18  0  0  0  0  0  0  0  0999 V2000
   15.7277    0.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7266   -0.7107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4414   -1.1235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4396    0.5295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1550    0.1203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1552   -0.7107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9457   -0.9673    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.4340   -0.2948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9453    0.3773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2000    1.1620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0069    1.3338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2616    2.1185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0118   -1.1226    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   19.5591    0.7209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1172    0.1082    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.0685    2.2903    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.7093    2.7314    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  4  1  1  0
  9 10  1  0
  5  6  1  0
 10 11  2  0
 11 12  1  0
  2  3  1  0
  2 13  1  0
  3  6  2  0
 11 14  1  0
  1  2  2  0
 14 15  3  0
  5  4  2  0
 12 16  1  0
  6  7  1  0
 12 17  2  0
M  END

Alternative Forms

Associated Targets(non-human)

Tdo2 Tryptophan 2,3-dioxygenase (195 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 230.20Molecular Weight (Monoisotopic): 230.0492AlogP: 2.30#Rotatable Bonds: 2
Polar Surface Area: 76.88Molecular Species: ACIDHBA: 2HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 2.32CX Basic pKa: CX LogP: 2.19CX LogD: -1.33
Aromatic Rings: 2Heavy Atoms: 17QED Weighted: 0.61Np Likeness Score: -0.86

References

1. Dolusić E, Larrieu P, Moineaux L, Stroobant V, Pilotte L, Colau D, Pochet L, Van den Eynde B, Masereel B, Wouters J, Frédérick R..  (2011)  Tryptophan 2,3-dioxygenase (TDO) inhibitors. 3-(2-(pyridyl)ethenyl)indoles as potential anticancer immunomodulators.,  54  (15): [PMID:21726069] [10.1021/jm2006782]

Source