The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4beta-(E)-3-(4-Methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)acrylamido podophyllotoxin ID: ALA1813298
PubChem CID: 56678562
Max Phase: Preclinical
Molecular Formula: C41H41NO12
Molecular Weight: 739.77
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(/C=C(/C(=O)N[C@@H]2c3cc4c(cc3[C@@H](c3cc(OC)c(OC)c(OC)c3)[C@H]3C(=O)OC[C@@H]32)OCO4)c2cc(OC)c(OC)c(OC)c2)cc1
Standard InChI: InChI=1S/C41H41NO12/c1-45-24-10-8-21(9-11-24)12-25(22-13-31(46-2)38(50-6)32(14-22)47-3)40(43)42-37-27-18-30-29(53-20-54-30)17-26(27)35(36-28(37)19-52-41(36)44)23-15-33(48-4)39(51-7)34(16-23)49-5/h8-18,28,35-37H,19-20H2,1-7H3,(H,42,43)/b25-12+/t28-,35+,36-,37+/m0/s1
Standard InChI Key: JFJGFXLTTPRDOU-SZXYIIICSA-N
Molfile:
RDKit 2D
56 62 0 0 0 0 0 0 0 0999 V2000
-5.3931 -20.7083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3943 -21.5357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6794 -21.9485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9630 -21.5352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9659 -20.7047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6812 -20.2955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6796 -22.7735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9653 -23.1862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9655 -24.0112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2511 -24.4239 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.2537 -22.7730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5391 -23.1874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8250 -22.7757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8243 -21.9499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5437 -21.5373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2549 -21.9514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6800 -24.4235 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2513 -25.2489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2560 -26.8935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2593 -27.7185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9772 -28.1229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2715 -29.3635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5536 -28.9551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9825 -28.9442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5466 -28.1275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7002 -29.3512 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.4114 -28.9331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2780 -30.1884 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9957 -30.5954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8422 -29.3729 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8483 -30.1979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5357 -25.6548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5360 -26.4801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7512 -26.7355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2658 -26.0679 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7507 -25.4001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4966 -27.5202 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9685 -26.4770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9635 -25.6588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6684 -25.2472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6744 -26.8818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3799 -26.4739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3817 -25.6530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1704 -25.4010 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.6476 -26.0661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1649 -26.7292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5464 -20.7123 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8333 -20.2975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1103 -21.5366 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3954 -21.9483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1108 -23.1888 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1114 -24.0138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5417 -24.8292 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.5417 -27.3042 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.6837 -19.4705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9705 -19.0559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12 13 1 0
24 26 1 0
1 2 2 0
26 27 1 0
13 14 2 0
22 28 1 0
3 7 1 0
28 29 1 0
14 15 1 0
23 30 1 0
3 4 2 0
30 31 1 0
32 33 1 0
15 16 2 0
16 11 1 0
8 11 1 0
7 8 2 0
9 17 2 0
33 34 1 0
34 35 1 0
35 36 1 0
32 36 1 0
34 37 2 0
18 10 1 1
18 39 1 0
38 39 2 0
8 9 1 0
39 40 1 0
40 43 2 0
18 32 1 0
42 41 2 0
41 38 1 0
42 43 1 0
38 19 1 0
19 33 1 0
4 5 1 0
19 20 1 6
20 21 2 0
43 44 1 0
44 45 1 0
45 46 1 0
46 42 1 0
9 10 1 0
15 47 1 0
22 23 1 0
47 48 1 0
2 3 1 0
14 49 1 0
5 6 2 0
49 50 1 0
11 12 2 0
13 51 1 0
6 1 1 0
51 52 1 0
20 25 1 0
32 53 1 6
21 24 1 0
33 54 1 1
24 22 2 0
6 55 1 0
23 25 2 0
55 56 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 739.77Molecular Weight (Monoisotopic): 739.2629AlogP: 5.81#Rotatable Bonds: 12Polar Surface Area: 138.47Molecular Species: NEUTRALHBA: 12HBD: 1#RO5 Violations: 3HBA (Lipinski): 13HBD (Lipinski): 1#RO5 Violations (Lipinski): 3CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.73CX LogD: 4.73Aromatic Rings: 4Heavy Atoms: 54QED Weighted: 0.11Np Likeness Score: 0.67
References 1. Kamal A, Suresh P, Janaki Ramaiah M, Mallareddy A, Kumar BA, Raju P, Vinay Gopal J, Pushpavalli SN, Lavanya A, Sarma P, Pal-Bhadra M.. (2011) Synthesis and biological evaluation of 4β-acrylamidopodophyllotoxin congeners as DNA damaging agents., 19 (15): [PMID:21737288 ] [10.1016/j.bmc.2011.06.017 ]