3-(4-Nitro-phenylsulfanyl)-1,3-diphenylpropan-1-one

ID: ALA1819223

PubChem CID: 56672128

Max Phase: Preclinical

Molecular Formula: C21H17NO3S

Molecular Weight: 363.44

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(CC(Sc1ccc([N+](=O)[O-])cc1)c1ccccc1)c1ccccc1

Standard InChI:  InChI=1S/C21H17NO3S/c23-20(16-7-3-1-4-8-16)15-21(17-9-5-2-6-10-17)26-19-13-11-18(12-14-19)22(24)25/h1-14,21H,15H2

Standard InChI Key:  MNEXHRFTJIQXRK-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
   12.4777   -7.1375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4766   -7.9648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1914   -8.3777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9078   -7.9644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9050   -7.1338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1896   -6.7247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6230   -8.3757    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   15.3368   -7.9621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0519   -8.3735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3355   -7.1371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0493   -6.7235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0480   -5.8985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7644   -7.1349    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.0485   -9.1969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7628   -9.6082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4776   -9.1945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4736   -8.3653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7588   -7.9577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7629   -5.4899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7620   -4.6657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0463   -4.2535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3302   -4.6716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3346   -5.4944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7625   -6.7254    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0481   -7.1381    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.7623   -5.9004    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 11 13  2  0
  1  2  2  0
  9 14  2  0
  4  7  1  0
 14 15  1  0
  3  4  2  0
 15 16  2  0
  7  8  1  0
 16 17  1  0
 17 18  2  0
 18  9  1  0
  8  9  1  0
 12 19  2  0
  4  5  1  0
 19 20  1  0
  8 10  1  0
 20 21  2  0
  2  3  1  0
 21 22  1  0
 10 11  1  0
 22 23  2  0
 23 12  1  0
  5  6  2  0
 11 12  1  0
  6  1  1  0
 24 25  2  0
 24 26  1  0
  1 24  1  0
M  CHG  2  24   1  26  -1
M  END

Alternative Forms

Associated Targets(Human)

Ishikawa (877 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MDA-MB-231 (73002 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MCF7 (126967 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 363.44Molecular Weight (Monoisotopic): 363.0929AlogP: 5.70#Rotatable Bonds: 7
Polar Surface Area: 60.21Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.59CX LogD: 5.59
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.23Np Likeness Score: -1.00

References

1. Kumar A, Tripathi VD, Kumar P, Gupta LP, Akanksha, Trivedi R, Bid H, Nayak VL, Siddiqui JA, Chakravarti B, Saxena R, Dwivedi A, Siddiquee MI, Siddiqui U, Konwar R, Chattopadhyay N..  (2011)  Design and synthesis of 1,3-biarylsulfanyl derivatives as new anti-breast cancer agents.,  19  (18): [PMID:21871812] [10.1016/j.bmc.2011.07.056]

Source