The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(aR)-(3S)-1-{4-[{4-Chloro-2-[(S)-hydroxy(2-methoxyphenyl)methyl]-6-(propan-2-yloxy)phenyl}(2,2-dimethylpropyl)amino]-4-oxobutanoyl}piperidine-3-carboxylic acid ID: ALA1819577
PubChem CID: 53379397
Max Phase: Preclinical
Molecular Formula: C32H43ClN2O7
Molecular Weight: 603.16
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccccc1[C@@H](O)c1cc(Cl)cc(OC(C)C)c1N(CC(C)(C)C)C(=O)CCC(=O)N1CCC[C@H](C(=O)O)C1
Standard InChI: InChI=1S/C32H43ClN2O7/c1-20(2)42-26-17-22(33)16-24(30(38)23-11-7-8-12-25(23)41-6)29(26)35(19-32(3,4)5)28(37)14-13-27(36)34-15-9-10-21(18-34)31(39)40/h7-8,11-12,16-17,20-21,30,38H,9-10,13-15,18-19H2,1-6H3,(H,39,40)/t21-,30+/m0/s1
Standard InChI Key: CLELLBMJLWSCHW-URAOTHONSA-N
Molfile:
RDKit 2D
42 44 0 0 0 0 0 0 0 0999 V2000
-5.0139 -26.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0151 -27.1273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3003 -27.5402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5838 -27.1269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5867 -26.2963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3021 -25.8872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7285 -25.8876 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-2.8738 -25.8811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8687 -27.5382 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8674 -28.3632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1549 -27.1246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1523 -28.7746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1510 -29.5996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4385 -28.3610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4417 -29.1833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4398 -27.5360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8769 -25.0561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1562 -26.2996 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1622 -24.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1650 -23.8215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8815 -23.4109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5968 -23.8306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5905 -24.6534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4475 -25.0579 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7333 -24.6451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1625 -25.4625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7260 -27.1224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0108 -27.5337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7030 -27.1201 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0095 -28.3587 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4130 -27.5346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1247 -27.1245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1277 -26.2992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4127 -25.8856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6948 -26.2974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4146 -25.0587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1298 -24.6475 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7009 -24.6449 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.3005 -28.3652 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.0150 -28.7775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7294 -28.3649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0153 -29.6025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20 21 2 0
2 3 1 0
21 22 1 0
9 11 1 0
22 23 2 0
23 17 1 0
5 6 2 0
19 24 1 0
10 12 1 0
24 25 1 0
6 1 1 0
8 26 1 1
12 13 1 0
16 27 1 0
1 2 2 0
27 28 1 0
12 14 1 0
28 29 1 0
1 7 1 0
28 30 2 0
29 31 1 0
12 15 1 0
3 4 2 0
11 16 1 0
5 8 1 0
8 17 1 0
29 35 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
11 18 2 0
4 9 1 0
36 37 1 0
36 38 2 0
34 36 1 1
17 19 2 0
3 39 1 0
4 5 1 0
39 40 1 0
19 20 1 0
40 41 1 0
9 10 1 0
40 42 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 603.16Molecular Weight (Monoisotopic): 602.2759AlogP: 5.70#Rotatable Bonds: 11Polar Surface Area: 116.61Molecular Species: ACIDHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.95CX Basic pKa: ┄CX LogP: 4.47CX LogD: 1.28Aromatic Rings: 2Heavy Atoms: 42QED Weighted: 0.34Np Likeness Score: -1.06
References 1. Ichikawa M, Yokomizo A, Itoh M, Haginoya N, Sugita K, Usui H, Terayama K, Kanda A.. (2011) Discovery of atrop fixed alkoxy-aminobenzhydrol derivatives: novel, highly potent and orally efficacious squalene synthase inhibitors., 19 (17): [PMID:21802309 ] [10.1016/j.bmc.2011.07.007 ]