The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-alpha-Boc-N-epsilon-2-chloro benzyloxycarbonyl-L-lysine-p-nitrophenylester ID: ALA1824791
PubChem CID: 56678909
Max Phase: Preclinical
Molecular Formula: C25H30ClN3O8
Molecular Weight: 535.98
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)OC(=O)N[C@@H](CCCCNC(=O)OCc1ccccc1Cl)C(=O)Oc1ccc([N+](=O)[O-])cc1
Standard InChI: InChI=1S/C25H30ClN3O8/c1-25(2,3)37-24(32)28-21(22(30)36-19-13-11-18(12-14-19)29(33)34)10-6-7-15-27-23(31)35-16-17-8-4-5-9-20(17)26/h4-5,8-9,11-14,21H,6-7,10,15-16H2,1-3H3,(H,27,31)(H,28,32)/t21-/m0/s1
Standard InChI Key: XQGKAKKXKDUYJS-NRFANRHFSA-N
Molfile:
RDKit 2D
37 38 0 0 0 0 0 0 0 0999 V2000
6.3127 -0.0740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5968 -1.3115 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5968 -0.4865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8851 -0.0740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1693 -0.4865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4534 -0.0740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7375 -0.4865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0258 -0.0740 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0286 -0.4865 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3127 0.7510 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3100 -0.4865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3100 -1.3115 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5983 -0.0740 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1176 -0.4865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8335 -0.0740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5452 -0.4865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2610 -0.0740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2610 0.7510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5452 1.1635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8335 0.7510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5452 -1.3115 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
6.3127 -1.7240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3127 -2.5490 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0286 -1.3115 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7403 -1.7240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0286 1.1635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0286 1.9885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7403 2.4010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4561 1.9885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4561 1.1635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7403 0.7510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1720 2.4010 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1720 3.2260 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.8837 1.9885 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7389 -2.5490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4554 -1.3127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4500 -2.1333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
1 9 2 0
1 10 1 0
11 12 2 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
15 20 2 0
13 14 1 0
11 13 1 0
16 21 1 0
8 11 1 0
22 23 2 0
22 24 1 0
24 25 1 0
2 22 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
26 31 2 0
32 33 2 0
32 34 1 0
29 32 1 0
10 26 1 0
25 35 1 0
3 2 1 1
25 36 1 0
1 3 1 0
25 37 1 0
M CHG 2 32 1 34 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 535.98Molecular Weight (Monoisotopic): 535.1721AlogP: 5.14#Rotatable Bonds: 11Polar Surface Area: 146.10Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 3CX Acidic pKa: 12.72CX Basic pKa: ┄CX LogP: 5.29CX LogD: 5.29Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.13Np Likeness Score: -1.06
References 1. Çakmak R, Durdagi S, Ekinci D, Sentürk M, Topal G.. (2011) Design, synthesis and biological evaluation of novel nitroaromatic compounds as potent glutathione reductase inhibitors., 21 (18): [PMID:21795044 ] [10.1016/j.bmcl.2011.07.002 ]