The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-3-[4-(3-Isopropyl-1H-indol-5-yloxy)-3,5-bis-trifluoromethyl-phenyl]-acrylic acid ID: ALA182735
PubChem CID: 10161481
Max Phase: Preclinical
Molecular Formula: C22H17F6NO3
Molecular Weight: 457.37
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)c1c[nH]c2ccc(Oc3c(C(F)(F)F)cc(/C=C/C(=O)O)cc3C(F)(F)F)cc12
Standard InChI: InChI=1S/C22H17F6NO3/c1-11(2)15-10-29-18-5-4-13(9-14(15)18)32-20-16(21(23,24)25)7-12(3-6-19(30)31)8-17(20)22(26,27)28/h3-11,29H,1-2H3,(H,30,31)/b6-3+
Standard InChI Key: ZOZISPMEYNRQNA-ZZXKWVIFSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
0.5292 -0.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2417 0.6583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5292 0.2458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1250 0.4833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2292 1.4833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1875 -1.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3458 0.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6083 -0.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1250 -0.8417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3458 -0.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1958 0.6583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2417 -0.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9625 0.2458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1292 -0.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4125 -0.5542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7042 -0.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6333 0.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9667 -0.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9125 0.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8417 -0.5292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4042 1.4708 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.2250 2.3083 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.9083 -1.4167 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.6083 -0.2792 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.2292 -1.7167 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.0542 1.4833 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.3833 1.2708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6333 -1.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9125 -0.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1500 -1.7792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.1833 1.4458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8250 1.8833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 1 2 0
4 7 1 0
5 2 1 0
6 1 1 0
7 17 1 0
8 4 2 0
9 10 1 0
10 28 1 0
11 3 1 0
12 1 1 0
13 18 1 0
14 15 1 0
15 16 2 0
16 18 1 0
17 19 2 0
18 12 2 0
19 11 1 0
20 14 2 0
21 5 1 0
22 5 1 0
23 6 1 0
24 6 1 0
25 6 1 0
26 5 1 0
27 4 1 0
28 29 2 0
29 19 1 0
30 14 1 0
31 27 1 0
32 27 1 0
13 2 2 0
10 7 2 0
8 9 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 457.37Molecular Weight (Monoisotopic): 457.1113AlogP: 7.22#Rotatable Bonds: 5Polar Surface Area: 62.32Molecular Species: ACIDHBA: 2HBD: 2#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 2.82CX Basic pKa: ┄CX LogP: 6.74CX LogD: 3.24Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.31Np Likeness Score: -0.12
References 1. Haning H, Woltering M, Mueller U, Schmidt G, Schmeck C, Voehringer V, Kretschmer A, Pernerstorfer J.. (2005) Novel heterocyclic thyromimetics., 15 (7): [PMID:15780617 ] [10.1016/j.bmcl.2005.02.028 ]