(E)-3-[4-(3-Isopropyl-1H-indol-5-yloxy)-3,5-bis-trifluoromethyl-phenyl]-acrylic acid

ID: ALA182735

PubChem CID: 10161481

Max Phase: Preclinical

Molecular Formula: C22H17F6NO3

Molecular Weight: 457.37

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)c1c[nH]c2ccc(Oc3c(C(F)(F)F)cc(/C=C/C(=O)O)cc3C(F)(F)F)cc12

Standard InChI:  InChI=1S/C22H17F6NO3/c1-11(2)15-10-29-18-5-4-13(9-14(15)18)32-20-16(21(23,24)25)7-12(3-6-19(30)31)8-17(20)22(26,27)28/h3-11,29H,1-2H3,(H,30,31)/b6-3+

Standard InChI Key:  ZOZISPMEYNRQNA-ZZXKWVIFSA-N

Molfile:  

     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
    0.5292   -0.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2417    0.6583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5292    0.2458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1250    0.4833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2292    1.4833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1875   -1.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3458    0.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6083   -0.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1250   -0.8417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3458   -0.5917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1958    0.6583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2417   -0.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9625    0.2458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1292   -0.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4125   -0.5542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7042   -0.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6333    0.6458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9667   -0.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9125    0.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8417   -0.5292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4042    1.4708    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.2250    2.3083    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9083   -1.4167    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6083   -0.2792    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.2292   -1.7167    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.0542    1.4833    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3833    1.2708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6333   -1.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9125   -0.5917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1500   -1.7792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1833    1.4458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8250    1.8833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  1  2  0
  4  7  1  0
  5  2  1  0
  6  1  1  0
  7 17  1  0
  8  4  2  0
  9 10  1  0
 10 28  1  0
 11  3  1  0
 12  1  1  0
 13 18  1  0
 14 15  1  0
 15 16  2  0
 16 18  1  0
 17 19  2  0
 18 12  2  0
 19 11  1  0
 20 14  2  0
 21  5  1  0
 22  5  1  0
 23  6  1  0
 24  6  1  0
 25  6  1  0
 26  5  1  0
 27  4  1  0
 28 29  2  0
 29 19  1  0
 30 14  1  0
 31 27  1  0
 32 27  1  0
 13  2  2  0
 10  7  2  0
  8  9  1  0
M  END

Associated Targets(Human)

THRA Tclin Thyroid hormone receptor (146 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 457.37Molecular Weight (Monoisotopic): 457.1113AlogP: 7.22#Rotatable Bonds: 5
Polar Surface Area: 62.32Molecular Species: ACIDHBA: 2HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 2.82CX Basic pKa: CX LogP: 6.74CX LogD: 3.24
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.31Np Likeness Score: -0.12

References

1. Haning H, Woltering M, Mueller U, Schmidt G, Schmeck C, Voehringer V, Kretschmer A, Pernerstorfer J..  (2005)  Novel heterocyclic thyromimetics.,  15  (7): [PMID:15780617] [10.1016/j.bmcl.2005.02.028]

Source