The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-carbamimidoyl-3-(4-methoxybenzamido)-4-(3-(4-(2,3,4-trimethoxybenzyl)piperazin-1-yl)propoxy)benzamide ID: ALA1829131
PubChem CID: 54770443
Max Phase: Preclinical
Molecular Formula: C33H42N6O7
Molecular Weight: 634.73
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C(=O)Nc2cc(C(=O)NC(=N)N)ccc2OCCCN2CCN(Cc3ccc(OC)c(OC)c3OC)CC2)cc1
Standard InChI: InChI=1S/C33H42N6O7/c1-42-25-10-6-22(7-11-25)31(40)36-26-20-23(32(41)37-33(34)35)8-12-27(26)46-19-5-14-38-15-17-39(18-16-38)21-24-9-13-28(43-2)30(45-4)29(24)44-3/h6-13,20H,5,14-19,21H2,1-4H3,(H,36,40)(H4,34,35,37,41)
Standard InChI Key: FPQJAKQEXYFLBN-UHFFFAOYSA-N
Molfile:
RDKit 2D
46 49 0 0 0 0 0 0 0 0999 V2000
-2.6740 -1.9654 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.9572 -2.3737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9539 -3.1969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2378 -3.6051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5248 -3.1884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5323 -2.3592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2489 -1.9547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2586 -1.1241 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1926 -3.5958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1985 -4.4208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.9041 -3.1782 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9159 -4.8281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9219 -5.6531 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.6274 -4.4105 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5490 -0.7033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1702 -1.1074 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.5587 0.1217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1520 0.5384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1427 1.3626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5771 1.7675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2890 1.3422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2762 0.5194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.8194 -1.1541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.8182 -1.9815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.1081 -2.3944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.3912 -1.9810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.3883 -1.1505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.1063 -0.7414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.1121 0.0836 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-8.3920 0.4983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.5298 -0.7418 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-10.5296 0.0832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.5368 -2.3934 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-11.2476 -1.9804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.6762 -0.7353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.9589 -1.1451 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.9594 -1.9673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2463 -2.3770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.5300 -1.9653 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.5311 -1.1394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2524 -0.7251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8155 -2.3779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1011 -1.9654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3866 -2.3779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5879 2.5924 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1212 3.0142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9 11 2 0
5 6 1 0
23 24 2 0
10 12 1 0
24 25 1 0
1 2 1 0
25 26 2 0
12 13 1 0
26 27 1 0
6 7 2 0
27 28 2 0
28 23 1 0
12 14 2 0
28 29 1 0
7 2 1 0
29 30 1 0
8 15 1 0
23 31 1 0
3 4 1 0
31 32 1 0
15 16 2 0
24 33 1 0
7 8 1 0
33 34 1 0
15 17 1 0
27 35 1 0
35 36 1 0
36 37 1 0
17 18 2 0
5 9 1 0
18 19 1 0
4 5 2 0
19 20 2 0
36 41 1 0
37 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
9 10 1 0
39 42 1 0
20 21 1 0
42 43 1 0
2 3 2 0
43 44 1 0
44 1 1 0
21 22 2 0
20 45 1 0
22 17 1 0
45 46 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 634.73Molecular Weight (Monoisotopic): 634.3115AlogP: 3.18#Rotatable Bonds: 14Polar Surface Area: 160.70Molecular Species: NEUTRALHBA: 10HBD: 4#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.73CX Basic pKa: 7.45CX LogP: 2.50CX LogD: 2.09Aromatic Rings: 3Heavy Atoms: 46QED Weighted: 0.12Np Likeness Score: -1.01
References 1. Jin L, Jiang XM, Du P, Xu J, Gong GQ, Wang QJ, Xu YG.. (2011) Synthesis and Na+/H+ exchanger inhibitory activity of benzoylguanidine derivatives., 46 (9): [PMID:21724305 ] [10.1016/j.ejmech.2011.06.011 ]