The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-carbamimidoyl-3-(4-methylphenylsulfonamido)-4-(3-(4-(2,3,4-trimethoxybenzyl)piperazin-1-yl)propoxy)benzamide ID: ALA1829133
PubChem CID: 54770445
Max Phase: Preclinical
Molecular Formula: C32H42N6O7S
Molecular Weight: 654.79
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CN2CCN(CCCOc3ccc(C(=O)NC(=N)N)cc3NS(=O)(=O)c3ccc(C)cc3)CC2)c(OC)c1OC
Standard InChI: InChI=1S/C32H42N6O7S/c1-22-6-10-25(11-7-22)46(40,41)36-26-20-23(31(39)35-32(33)34)8-12-27(26)45-19-5-14-37-15-17-38(18-16-37)21-24-9-13-28(42-2)30(44-4)29(24)43-3/h6-13,20,36H,5,14-19,21H2,1-4H3,(H4,33,34,35,39)
Standard InChI Key: AMVZKGKPUOJLBR-UHFFFAOYSA-N
Molfile:
RDKit 2D
46 49 0 0 0 0 0 0 0 0999 V2000
23.3760 -0.9112 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.0928 -1.3195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0961 -2.1427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8122 -2.5510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5252 -2.1343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5177 -1.3050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8011 -0.9005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7914 -0.0699 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.2426 -2.5416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2485 -3.3666 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.9541 -2.1240 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.9659 -3.7740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9719 -4.5989 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.6774 -3.3563 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.5010 0.3509 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
25.4913 1.1758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2020 1.5926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1927 2.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4729 2.8217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7610 2.3964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7738 1.5736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2361 -0.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2349 -0.9273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9497 -1.3402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6662 -0.9269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6633 -0.0963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9479 0.3128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9455 1.1378 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.6587 1.5524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5215 0.3124 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5213 1.1374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5201 -1.3393 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8060 -0.9262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3762 0.3189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0922 -0.0909 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.0927 -0.9131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8047 -1.3229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5200 -0.9112 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.5189 -0.0852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8024 0.3291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2345 -1.3237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9489 -0.9112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6634 -1.3237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4621 3.6466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9083 -0.3583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.2958 0.5708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22 23 2 0
5 6 1 0
23 24 1 0
10 12 1 0
24 25 2 0
1 2 1 0
25 26 1 0
12 13 1 0
26 27 2 0
27 22 1 0
6 7 2 0
27 28 1 0
12 14 2 0
28 29 1 0
7 2 1 0
22 30 1 0
8 15 1 0
30 31 1 0
3 4 1 0
23 32 1 0
15 16 1 0
32 33 1 0
7 8 1 0
26 34 1 0
16 17 2 0
34 35 1 0
35 36 1 0
17 18 1 0
5 9 1 0
18 19 2 0
4 5 2 0
35 40 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
19 20 1 0
38 41 1 0
9 10 1 0
41 42 1 0
20 21 2 0
42 43 1 0
43 1 1 0
21 16 1 0
19 44 1 0
2 3 2 0
15 45 2 0
9 11 2 0
15 46 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 654.79Molecular Weight (Monoisotopic): 654.2836AlogP: 3.03#Rotatable Bonds: 14Polar Surface Area: 168.54Molecular Species: NEUTRALHBA: 10HBD: 4#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 6.97CX Basic pKa: 7.59CX LogP: 1.72CX LogD: 1.86Aromatic Rings: 3Heavy Atoms: 46QED Weighted: 0.12Np Likeness Score: -1.27
References 1. Jin L, Jiang XM, Du P, Xu J, Gong GQ, Wang QJ, Xu YG.. (2011) Synthesis and Na+/H+ exchanger inhibitory activity of benzoylguanidine derivatives., 46 (9): [PMID:21724305 ] [10.1016/j.ejmech.2011.06.011 ]