2-{7,8,15,16-tetraoxadispiro[5.2.5^{9}.2^{6}]hexadecan-3-yl}acetic acid

ID: ALA1830036

Cas Number: 923267-21-4

PubChem CID: 15946708

Max Phase: Preclinical

Molecular Formula: C14H22O6

Molecular Weight: 286.32

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)CC1CCC2(CC1)OOC1(CCCCC1)OO2

Standard InChI:  InChI=1S/C14H22O6/c15-12(16)10-11-4-8-14(9-5-11)19-17-13(18-20-14)6-2-1-3-7-13/h11H,1-10H2,(H,15,16)

Standard InChI Key:  KYUJXHOKTSPIFK-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 20 22  0  0  0  0  0  0  0  0999 V2000
   -2.6000   -9.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0167   -9.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8411   -9.0900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2551   -9.8075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8384  -10.5242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0077  -10.5233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9417   -9.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3583   -9.0875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1827   -9.0900    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1801  -10.5242    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3494  -10.5233    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5333  -10.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2833  -10.5193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6979   -9.8111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2895   -9.0986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5333   -9.0943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5229   -9.8148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9321  -10.5312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7571  -10.5350    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5163  -11.2438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  8  9  1  0
  9  1  1  0
  1 10  1  0
 10 11  1  0
  7 12  1  0
  4  5  1  0
  5  6  1  0
  7  8  1  0
  1  2  1  0
  7 16  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
  1  6  1  0
 14 17  1  0
  2  3  1  0
 17 18  1  0
  3  4  1  0
 18 19  2  0
  7 11  1  0
 18 20  1  0
M  END

Associated Targets(non-human)

Fasciola hepatica (191 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 286.32Molecular Weight (Monoisotopic): 286.1416AlogP: 2.92#Rotatable Bonds: 2
Polar Surface Area: 74.22Molecular Species: ACIDHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 3.80CX Basic pKa: CX LogP: 3.37CX LogD: 0.11
Aromatic Rings: Heavy Atoms: 20QED Weighted: 0.79Np Likeness Score: 0.66

References

1. Wang X, Zhao Q, Vargas M, Dong Y, Sriraghavan K, Keiser J, Vennerstrom JL..  (2011)  The activity of dispiro peroxides against Fasciola hepatica.,  21  (18): [PMID:21802291] [10.1016/j.bmcl.2011.07.024]

Source