The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-[4-(3-Isopropyl-1H-indol-5-yloxy)-3,5-bis-trifluoromethyl-phenyl]-propionic acid ID: ALA183170
PubChem CID: 10298167
Max Phase: Preclinical
Molecular Formula: C22H19F6NO3
Molecular Weight: 459.39
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)c1c[nH]c2ccc(Oc3c(C(F)(F)F)cc(CCC(=O)O)cc3C(F)(F)F)cc12
Standard InChI: InChI=1S/C22H19F6NO3/c1-11(2)15-10-29-18-5-4-13(9-14(15)18)32-20-16(21(23,24)25)7-12(3-6-19(30)31)8-17(20)22(26,27)28/h4-5,7-11,29H,3,6H2,1-2H3,(H,30,31)
Standard InChI Key: NMTUNXAZFPBDHE-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
0.5292 -0.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2417 0.6583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5292 0.2458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1250 0.4833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2292 1.4833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1875 -1.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3458 0.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6083 -0.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1250 -0.8417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3458 -0.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1958 0.6583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2417 -0.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9625 0.2458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6333 0.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1292 -0.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9125 0.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9667 -0.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8417 -0.5292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6083 -0.2792 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.2250 2.3083 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.0542 1.4833 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.4042 1.4708 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.2292 -1.7167 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.9083 -1.4167 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.3833 1.2708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6333 -1.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4125 -0.5542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9125 -0.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7042 -0.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1500 -1.7792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.1833 1.4458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8250 1.8833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 1 2 0
4 7 1 0
5 2 1 0
6 1 1 0
7 14 1 0
8 4 2 0
9 10 1 0
10 26 1 0
11 3 1 0
12 1 1 0
13 17 1 0
14 16 2 0
15 27 1 0
16 11 1 0
17 12 2 0
18 15 2 0
19 6 1 0
20 5 1 0
21 5 1 0
22 5 1 0
23 6 1 0
24 6 1 0
25 4 1 0
26 28 2 0
27 29 1 0
28 16 1 0
29 17 1 0
30 15 1 0
31 25 1 0
32 25 1 0
13 2 2 0
10 7 2 0
8 9 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 459.39Molecular Weight (Monoisotopic): 459.1269AlogP: 7.14#Rotatable Bonds: 6Polar Surface Area: 62.32Molecular Species: ACIDHBA: 2HBD: 2#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.14CX Basic pKa: ┄CX LogP: 6.66CX LogD: 3.20Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.39Np Likeness Score: -0.15
References 1. Haning H, Woltering M, Mueller U, Schmidt G, Schmeck C, Voehringer V, Kretschmer A, Pernerstorfer J.. (2005) Novel heterocyclic thyromimetics., 15 (7): [PMID:15780617 ] [10.1016/j.bmcl.2005.02.028 ]