The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-[(1-Benzyl-pyrrolidin-3-yl)-(2,2-diphenyl-ethyl)-amino]-3-(1H-imidazol-4-yl)-propionic acid ID: ALA183296
PubChem CID: 44390077
Max Phase: Preclinical
Molecular Formula: C31H34N4O2
Molecular Weight: 494.64
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)CC(c1c[nH]cn1)N(CC(c1ccccc1)c1ccccc1)C1CCN(Cc2ccccc2)C1
Standard InChI: InChI=1S/C31H34N4O2/c36-31(37)18-30(29-19-32-23-33-29)35(27-16-17-34(21-27)20-24-10-4-1-5-11-24)22-28(25-12-6-2-7-13-25)26-14-8-3-9-15-26/h1-15,19,23,27-28,30H,16-18,20-22H2,(H,32,33)(H,36,37)
Standard InChI Key: PSHRGFIELWHFDG-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
-0.5833 -0.3167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2875 0.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0000 -0.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5833 -1.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3708 -0.3167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2875 0.9208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1375 0.0958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5417 1.3708 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1375 -1.5542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0083 1.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6875 -1.6000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.4000 -1.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1250 0.8833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9708 -1.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9542 0.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0083 2.1625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2125 0.8833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1375 -2.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8500 -1.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5375 2.1958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7208 0.9208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1167 2.7833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8500 -0.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8500 -2.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5833 -2.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5542 -1.5542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9167 2.5708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9000 3.5833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8500 -3.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5833 -3.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2792 -1.1417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5542 0.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5042 3.1708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4792 4.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2792 -0.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1375 -4.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2875 3.9625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 1 1 0
5 3 1 0
6 2 1 0
7 1 1 0
8 13 1 0
9 4 1 0
10 6 1 0
11 14 1 0
12 5 2 0
13 7 1 0
14 3 2 0
15 7 1 0
16 10 2 0
17 15 1 0
18 9 1 0
19 9 1 0
20 8 1 0
21 10 1 0
22 20 1 0
23 19 1 0
24 18 1 0
25 18 2 0
26 19 2 0
27 22 2 0
28 22 1 0
29 24 2 0
30 25 1 0
31 26 1 0
32 23 2 0
33 27 1 0
34 28 2 0
35 31 2 0
36 30 2 0
37 34 1 0
17 8 1 0
12 11 1 0
35 32 1 0
36 29 1 0
37 33 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 494.64Molecular Weight (Monoisotopic): 494.2682AlogP: 5.33#Rotatable Bonds: 11Polar Surface Area: 72.46Molecular Species: ZWITTERIONHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.99CX Basic pKa: 8.84CX LogP: 2.28CX LogD: 2.28Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.29Np Likeness Score: -0.63
References 1. Saha AK, End DW.. (2005) Novel beta-(imidazol-4-yl)-beta-amino acids: solid-phase synthesis and study of their inhibitory activity against geranylgeranyl protein transferase type I., 15 (6): [PMID:15745827 ] [10.1016/j.bmcl.2005.01.042 ]