1-(1-Methyl-1H-indol-3-yl)-3-(3,4,5-trimethoxy-phenyl)-propenone

ID: ALA1834567

PubChem CID: 56657919

Max Phase: Preclinical

Molecular Formula: C21H21NO4

Molecular Weight: 351.40

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(/C=C/C(=O)c2cn(C)c3ccccc23)cc(OC)c1OC

Standard InChI:  InChI=1S/C21H21NO4/c1-22-13-16(15-7-5-6-8-17(15)22)18(23)10-9-14-11-19(24-2)21(26-4)20(12-14)25-3/h5-13H,1-4H3/b10-9+

Standard InChI Key:  ZRPMELYRKOUIQV-MDZDMXLPSA-N

Molfile:  

     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
    5.3545  -15.9583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5679  -16.7543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3665  -16.9660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9307  -15.3741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7288  -15.5841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9481  -16.3831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7788  -16.4171    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0693  -15.6395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4187  -15.1238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2350  -17.1044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4565  -14.3010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1852  -13.9201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7407  -13.8905    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9008  -14.3305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6151  -13.9171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3342  -14.3517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0354  -13.8974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0240  -13.0731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3008  -12.6755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5978  -13.0987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7279  -12.6528    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.7136  -11.8289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7580  -14.2833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4576  -13.8483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3778  -11.8565    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.5625  -11.5837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 14 15  1  0
  5  4  2  0
 15 16  2  0
  6  7  1  0
 16 17  1  0
  7  8  1  0
 17 18  2  0
  8  9  2  0
 18 19  1  0
  9  5  1  0
 19 20  2  0
 20 15  1  0
  4  1  1  0
  7 10  1  0
  5  6  1  0
  9 11  1  0
 11 12  1  0
  2  3  1  0
 21 22  1  0
 18 21  1  0
 11 13  2  0
  3  6  2  0
 23 24  1  0
 17 23  1  0
 12 14  2  0
  1  2  2  0
 25 26  1  0
 19 25  1  0
M  END

Associated Targets(Human)

RT-112 (346 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ABCG2 Tchem ATP-binding cassette sub-family G member 2 (4927 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 351.40Molecular Weight (Monoisotopic): 351.1471AlogP: 4.10#Rotatable Bonds: 6
Polar Surface Area: 49.69Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.74CX LogD: 3.74
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.50Np Likeness Score: -0.13

References

1. Martel-Frachet V, Kadri M, Boumendjel A, Ronot X..  (2011)  Structural requirement of arylindolylpropenones as anti-bladder carcinoma cells agents.,  19  (20): [PMID:21908193] [10.1016/j.bmc.2011.08.015]
2. Valdameri G, Gauthier C, Terreux R, Kachadourian R, Day BJ, Winnischofer SM, Rocha ME, Frachet V, Ronot X, Di Pietro A, Boumendjel A..  (2012)  Investigation of chalcones as selective inhibitors of the breast cancer resistance protein: critical role of methoxylation in both inhibition potency and cytotoxicity.,  55  (7): [PMID:22449016] [10.1021/jm2016528]

Source