The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Thailandepsin B ID: ALA1836145
PubChem CID: 56676500
Max Phase: Preclinical
Molecular Formula: C24H39N3O6S2
Molecular Weight: 529.73
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: Thailandepsin B | CHEMBL1836145|Thailandepsin B|BDBM50354084
Canonical SMILES: CCCC[C@H]1NC(=O)C[C@H]2/C=C/CCSSC[C@@H](NC1=O)C(=O)N[C@H]([C@@H](C)CC)[C@@H](O)CC(=O)O2
Standard InChI: InChI=1S/C24H39N3O6S2/c1-4-6-10-17-23(31)26-18-14-35-34-11-8-7-9-16(12-20(29)25-17)33-21(30)13-19(28)22(15(3)5-2)27-24(18)32/h7,9,15-19,22,28H,4-6,8,10-14H2,1-3H3,(H,25,29)(H,26,31)(H,27,32)/b9-7+/t15-,16+,17+,18+,19-,22+/m0/s1
Standard InChI Key: MUNWAZFRKGVMPQ-RIRJJDMNSA-N
Molfile:
RDKit 2D
38 39 0 0 0 0 0 0 0 0999 V2000
6.3787 -5.2165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1250 -6.0013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2860 -6.0307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0191 -6.8107 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1879 -6.8132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9203 -6.0306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1061 -6.0009 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8650 -5.2229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5162 -4.7356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2715 -3.9612 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5984 -3.9234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2586 -3.4416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9446 -3.9347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7109 -4.7244 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6161 -4.7482 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8927 -2.6459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5942 -2.2116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1659 -2.2556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5687 -1.3870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3016 -4.9883 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4122 -5.3683 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7746 -7.5271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9496 -7.5261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5380 -6.8111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7130 -6.8101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7947 -5.3680 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7251 -3.6674 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1468 -4.8169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1640 -4.9636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7757 -5.5173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5610 -5.2644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1726 -5.8180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3032 -10.0662 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.5680 -6.6610 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.9182 -3.4705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0158 -3.0397 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.8011 -4.2249 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.5397 -4.2296 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
16 17 1 0
4 5 1 0
16 18 1 1
5 6 1 0
17 19 1 0
6 7 1 0
9 20 2 0
3 4 1 0
6 21 2 0
8 9 1 0
5 22 1 6
9 10 1 0
22 23 1 0
35 10 1 0
23 24 1 0
7 8 1 0
24 25 1 0
11 12 1 0
12 13 1 0
3 26 2 0
13 14 1 0
13 27 2 0
11 35 1 0
8 28 1 0
1 14 1 0
1 29 1 0
29 30 2 0
11 15 1 6
30 31 1 0
1 2 1 0
31 32 1 0
35 16 1 0
32 33 1 0
2 3 1 0
28 34 1 0
35 36 1 1
34 33 1 0
8 37 1 1
1 38 1 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 529.73Molecular Weight (Monoisotopic): 529.2280AlogP: 2.08#Rotatable Bonds: 5Polar Surface Area: 133.83Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.93CX Basic pKa: ┄CX LogP: 1.70CX LogD: 1.70Aromatic Rings: ┄Heavy Atoms: 35QED Weighted: 0.24Np Likeness Score: 2.41
References 1. Wang C, Henkes LM, Doughty LB, He M, Wang D, Meyer-Almes FJ, Cheng YQ.. (2011) Thailandepsins: bacterial products with potent histone deacetylase inhibitory activities and broad-spectrum antiproliferative activities., 74 (10): [PMID:21793558 ] [10.1021/np200324x ] 2. Wang C, Flemming CJ, Cheng YQ.. (2012) Discovery and activity profiling of thailandepsins A through F, potent histone deacetylase inhibitors, from Burkholderia thailandensis E264., 3 (8): [PMID:23997923 ] [10.1039/c2md20024d ]