Your company account is blocked and you cannot place orders. If you have questions, please contact your company administrator.

4-[3-Acetyl-4-(3,4-dichloro-benzyloxy)-phenoxy]-butyronitrile

ID: ALA18643

PubChem CID: 44272275

Max Phase: Preclinical

Molecular Formula: C19H17Cl2NO3

Molecular Weight: 378.26

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)c1cc(OCCCC#N)ccc1OCc1ccc(Cl)c(Cl)c1

Standard InChI:  InChI=1S/C19H17Cl2NO3/c1-13(23)16-11-15(24-9-3-2-8-22)5-7-19(16)25-12-14-4-6-17(20)18(21)10-14/h4-7,10-11H,2-3,9,12H2,1H3

Standard InChI Key:  LJCFJHVECVSISY-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 25 26  0  0  0  0  0  0  0  0999 V2000
    4.4667   -3.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7917   -2.9375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0875   -4.5917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0167   -3.1750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7292   -3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9667   -2.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2875   -3.8292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3417   -4.0292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2625   -4.6292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5542   -3.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4042   -2.4417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5250   -5.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7875   -4.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0000   -3.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7292   -4.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -2.6042    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    2.8167   -3.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4833   -4.0292    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.6125   -4.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3500   -5.2625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5542   -4.4917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1417   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2000   -3.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9417   -3.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7667   -3.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  6  3  0
  3  1  1  0
  4  1  1  0
  5 10  1  0
  6 22  1  0
  7  1  2  0
  8 13  1  0
  9  3  1  0
 10 14  2  0
 11  4  2  0
 12  3  2  0
 13 19  2  0
 14 17  1  0
 15  7  1  0
 16  5  1  0
 17  9  1  0
 18  8  1  0
 19 14  1  0
 20 15  2  0
 21 15  1  0
 22 25  1  0
 23  4  1  0
 24 21  1  0
 25 24  1  0
 12 20  1  0
  5  8  2  0
M  END

Associated Targets(Human)

MAOA Tclin Monoamine oxidase (395 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Maob Monoamine oxidase B (2209 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Calculated Properties

Molecular Weight: 378.26Molecular Weight (Monoisotopic): 377.0585AlogP: 5.46#Rotatable Bonds: 8
Polar Surface Area: 59.32Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.21CX LogD: 4.21
Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.45Np Likeness Score: -1.02

References

1. Arvanitis AG, Scholfield EL, Grigoriadis D, Heytler PG, Bowdle J, Chorvat RJ.  (1996)  Alkylbenzyl ethers of hydroquinones as monoamine oxidase B inhibitors,  (2): [10.1016/0960-894X(95)00561-7]

Source