The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-{3-(3,5-Dimethoxy-phenyl)-7-[3-(4-methyl-piperazin-1-yl)-propylamino]-[1,6]naphthyridin-2-yl}-3-ethyl-urea ID: ALA188087
PubChem CID: 5330126
Max Phase: Preclinical
Molecular Formula: C27H37N7O3
Molecular Weight: 507.64
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCNC(=O)Nc1nc2cc(NCCCN3CCN(C)CC3)ncc2cc1-c1cc(OC)cc(OC)c1
Standard InChI: InChI=1S/C27H37N7O3/c1-5-28-27(35)32-26-23(19-13-21(36-3)16-22(14-19)37-4)15-20-18-30-25(17-24(20)31-26)29-7-6-8-34-11-9-33(2)10-12-34/h13-18H,5-12H2,1-4H3,(H,29,30)(H2,28,31,32,35)
Standard InChI Key: KZMWAICISUWYLE-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
0.5000 -0.1417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2167 -0.5625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.2208 -0.5542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.5000 0.6833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2167 1.0958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9333 -0.1417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2167 -1.3917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2208 1.0958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9333 0.6833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6458 -0.5542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3583 0.6833 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3583 -0.1417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6500 -3.0417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.2208 -3.8667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9292 0.6833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2167 1.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6458 1.0958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6417 1.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9292 2.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6417 1.0958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5042 -1.8042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9292 -1.8042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.0833 -0.5625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.2208 -3.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9375 -4.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9333 -2.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6500 -3.8667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3667 0.6750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9292 3.1708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3625 -2.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3625 -1.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5042 -4.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0750 -1.3875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6417 -1.3917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3625 -0.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6417 3.5833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6417 -0.5625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 2 0
4 1 1 0
5 4 1 0
6 3 1 0
7 2 1 0
8 4 2 0
9 8 1 0
10 6 2 0
11 17 1 0
12 10 1 0
13 30 1 0
14 25 1 0
15 5 2 0
16 5 1 0
17 9 2 0
18 19 1 0
19 16 2 0
20 15 1 0
21 7 2 0
22 7 1 0
23 12 1 0
24 26 1 0
25 27 1 0
26 13 1 0
27 13 1 0
28 20 1 0
29 19 1 0
30 31 1 0
31 33 1 0
32 14 1 0
33 23 1 0
34 22 1 0
35 28 1 0
36 29 1 0
37 34 1 0
9 6 1 0
20 18 2 0
11 12 2 0
14 24 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 507.64Molecular Weight (Monoisotopic): 507.2958AlogP: 3.50#Rotatable Bonds: 10Polar Surface Area: 103.88Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.61CX Basic pKa: 8.10CX LogP: 2.32CX LogD: 1.54Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.36Np Likeness Score: -1.21
References 1. Thompson AM, Delaney AM, Hamby JM, Schroeder MC, Spoon TA, Crean SM, Showalter HD, Denny WA.. (2005) Synthesis and structure-activity relationships of soluble 7-substituted 3-(3,5-dimethoxyphenyl)-1,6-naphthyridin-2-amines and related ureas as dual inhibitors of the fibroblast growth factor receptor-1 and vascular endothelial growth factor receptor-2 tyrosine kinases., 48 (14): [PMID:16000000 ] [10.1021/jm0500931 ]