The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID97362176 ID: ALA1894472
PubChem CID: 46259346
Max Phase: Preclinical
Molecular Formula: C23H21F3N4O2
Molecular Weight: 328.42
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(N2CCN(c3ccccc3C#N)CC2)nc2ccccc12.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C21H20N4.C2HF3O2/c1-16-14-21(23-19-8-4-3-7-18(16)19)25-12-10-24(11-13-25)20-9-5-2-6-17(20)15-22;3-2(4,5)1(6)7/h2-9,14H,10-13H2,1H3;(H,6,7)
Standard InChI Key: YVCNODOSAFGKAS-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
6.8724 -0.0330 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3013 -0.0330 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4434 0.7920 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0145 -0.8580 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5868 -0.4455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0158 -1.2705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0158 -0.4455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3013 -1.6830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5868 -1.2705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7289 1.2045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1579 -0.4455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8724 0.7920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4434 -0.0330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1579 1.2045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0145 0.7920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7302 -1.6830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7302 -0.0330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7289 2.0295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4447 -1.2705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4447 -0.4455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3013 -2.5080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3000 1.2045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0145 -0.0330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0145 2.4420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3000 2.0295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1786 0.0000 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.3536 0.8250 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.3536 -0.8250 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.8839 -0.7145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8839 0.7145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3536 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4714 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 5 1 0
1 11 1 0
1 12 1 0
2 5 1 0
2 7 2 0
3 10 1 0
3 13 1 0
3 14 1 0
4 23 3 0
5 9 2 0
6 7 1 0
6 8 2 0
6 16 1 0
7 17 1 0
8 9 1 0
8 21 1 0
10 15 2 0
10 18 1 0
11 13 1 0
12 14 1 0
15 22 1 0
15 23 1 0
16 19 2 0
17 20 2 0
18 24 2 0
19 20 1 0
22 25 2 0
24 25 1 0
26 31 1 0
27 31 1 0
28 31 1 0
29 32 2 0
30 32 1 0
31 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 328.42Molecular Weight (Monoisotopic): 328.1688AlogP: 3.74#Rotatable Bonds: 2Polar Surface Area: 43.16Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.59CX LogP: 4.94CX LogD: 4.88Aromatic Rings: 3Heavy Atoms: 25QED Weighted: 0.72Np Likeness Score: -1.62
References 1. PubChem BioAssay data set,