The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-pyridyl-cyanoguanidine derivative ID: ALA189478
PubChem CID: 53325701
Max Phase: Preclinical
Molecular Formula: C25H35Cl3N6O3
Molecular Weight: 502.04
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)[C@@H](N)C(=O)OC[n+]1ccc(N/C(=N/CCCCCCOc2ccc(Cl)cc2)NC#N)cc1.Cl.[Cl-]
Standard InChI: InChI=1S/C25H33ClN6O3.2ClH/c1-19(2)23(28)24(33)35-18-32-14-11-21(12-15-32)31-25(30-17-27)29-13-5-3-4-6-16-34-22-9-7-20(26)8-10-22;;/h7-12,14-15,19,23H,3-6,13,16,18,28H2,1-2H3,(H,29,30);2*1H/t23-;;/m1../s1
Standard InChI Key: CAVWZDUEUBYNLK-MQWQBNKOSA-N
Molfile:
RDKit 2D
37 36 0 0 0 0 0 0 0 0999 V2000
2.2547 -1.3409 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4.0164 -1.5041 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
7.5460 -3.6238 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6633 -2.8168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9379 -4.0321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6633 -3.6270 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9905 -5.2473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3664 -4.3555 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2682 -4.8391 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2682 -4.0289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3792 -2.4085 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9874 -6.0544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9347 -2.4117 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5652 -4.9208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5460 -2.8136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8269 -4.0289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1046 -2.8136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1046 -3.6238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8269 -2.4085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4095 -6.3810 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7096 -6.4594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2752 -1.6078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8370 -2.4243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8562 -1.2844 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-2.5530 -1.2059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2752 -2.4243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8370 -1.6078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5530 -2.8230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1085 -2.8230 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2219 -2.8168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2874 -6.1423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7096 -7.1095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3925 -2.4180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4997 -2.4117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3360 -2.8230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0520 -2.4180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7773 -2.8230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 11 1 0
5 6 1 0
6 4 1 0
7 9 1 0
8 5 3 0
9 10 1 0
10 3 1 0
11 17 1 0
12 7 1 0
13 4 2 0
14 7 2 0
3 15 2 0
16 3 1 0
17 18 1 0
18 16 2 0
19 15 1 0
12 20 1 1
21 12 1 0
22 26 2 0
23 29 1 0
24 22 1 0
25 27 2 0
26 28 1 0
27 23 1 0
28 23 2 0
29 33 1 0
30 13 1 0
31 21 1 0
32 21 1 0
33 35 1 0
34 30 1 0
35 36 1 0
36 37 1 0
37 34 1 0
19 17 2 0
25 22 1 0
M CHG 2 2 -1 3 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 502.04Molecular Weight (Monoisotopic): 501.2375AlogP: 3.59#Rotatable Bonds: 13Polar Surface Area: 125.64Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.47CX LogP: 0.38CX LogD: 0.04Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.07Np Likeness Score: -0.43
References 1. Binderup E, Björkling F, Hjarnaa PV, Latini S, Baltzer B, Carlsen M, Binderup L.. (2005) EB1627: a soluble prodrug of the potent anticancer cyanoguanidine CHS828., 15 (10): [PMID:15863303 ] [10.1016/j.bmcl.2005.03.064 ]