The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-tert-Butyl-3-{3-(3,5-dimethoxy-phenyl)-7-[3-(4-methyl-piperazin-1-yl)-propylamino]-[1,6]naphthyridin-2-yl}-urea ID: ALA189995
PubChem CID: 5330127
Max Phase: Preclinical
Molecular Formula: C29H41N7O3
Molecular Weight: 535.69
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(OC)cc(-c2cc3cnc(NCCCN4CCN(C)CC4)cc3nc2NC(=O)NC(C)(C)C)c1
Standard InChI: InChI=1S/C29H41N7O3/c1-29(2,3)34-28(37)33-27-24(20-14-22(38-5)17-23(15-20)39-6)16-21-19-31-26(18-25(21)32-27)30-8-7-9-36-12-10-35(4)11-13-36/h14-19H,7-13H2,1-6H3,(H,30,31)(H2,32,33,34,37)
Standard InChI Key: ABQSJCCISLWTEW-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
-0.6333 -0.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0917 -1.3792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3458 -1.3667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6333 -0.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0917 -2.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0875 0.2833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0583 -0.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3458 0.2833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0583 -0.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7708 -1.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4875 -0.1375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.4875 -0.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8042 -2.6167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7833 -3.8542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3458 -4.6875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0875 1.1083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8000 -0.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7708 0.2833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6250 -2.6167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5167 1.1083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8000 1.5208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5167 0.2833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5167 -2.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2083 -1.3792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.0708 -5.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3458 -3.8542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7833 -4.6875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0625 -3.4417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8000 2.3458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2375 -0.1417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.4958 -3.4417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4958 -2.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6333 -5.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2083 -2.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2292 -1.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9292 -2.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1042 -1.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5125 2.7583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2292 -0.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 2 0
4 1 1 0
5 2 1 0
6 4 1 0
7 3 1 0
8 4 2 0
9 8 1 0
10 7 2 0
11 18 1 0
12 10 1 0
13 5 1 0
14 31 1 0
15 26 1 0
16 6 1 0
17 6 2 0
18 9 2 0
19 5 2 0
20 22 2 0
21 16 2 0
22 17 1 0
23 13 1 0
24 12 1 0
25 27 1 0
26 28 1 0
27 14 1 0
28 14 1 0
29 21 1 0
30 22 1 0
31 32 1 0
32 34 1 0
33 15 1 0
34 24 1 0
35 23 1 0
36 23 1 0
37 23 1 0
38 29 1 0
39 30 1 0
9 7 1 0
20 21 1 0
11 12 2 0
25 15 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 535.69Molecular Weight (Monoisotopic): 535.3271AlogP: 4.28#Rotatable Bonds: 9Polar Surface Area: 103.88Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.59CX Basic pKa: 8.10CX LogP: 3.01CX LogD: 2.23Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.35Np Likeness Score: -1.09
References 1. Thompson AM, Delaney AM, Hamby JM, Schroeder MC, Spoon TA, Crean SM, Showalter HD, Denny WA.. (2005) Synthesis and structure-activity relationships of soluble 7-substituted 3-(3,5-dimethoxyphenyl)-1,6-naphthyridin-2-amines and related ureas as dual inhibitors of the fibroblast growth factor receptor-1 and vascular endothelial growth factor receptor-2 tyrosine kinases., 48 (14): [PMID:16000000 ] [10.1021/jm0500931 ]