The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID97362175 ID: ALA1903670
PubChem CID: 46259344
Max Phase: Preclinical
Molecular Formula: C17H19F3N2O2
Molecular Weight: 226.32
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(N2CCC[C@@H]2C)nc2ccccc12.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C15H18N2.C2HF3O2/c1-11-10-15(17-9-5-6-12(17)2)16-14-8-4-3-7-13(11)14;3-2(4,5)1(6)7/h3-4,7-8,10,12H,5-6,9H2,1-2H3;(H,6,7)/t12-;/m0./s1
Standard InChI Key: GPMDVHLHGNNJPJ-YDALLXLXSA-N
Molfile:
RDKit 2D
24 25 0 0 0 0 0 0 0 0999 V2000
4.7236 0.5949 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1525 0.5949 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4380 0.1824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8670 -0.6426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8670 0.1824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1525 -1.0551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4380 -0.6426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9699 0.2593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6373 1.4154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5814 -1.0551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5814 0.5949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4179 0.8724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8304 1.5869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2959 -0.6426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2959 0.1824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1525 -1.8801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7984 -0.5476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1786 0.0000 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.3536 0.8250 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.3536 -0.8250 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.8839 -0.7145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8839 0.7145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3536 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4714 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 3 1 0
1 8 1 0
1 9 1 0
2 3 1 0
2 5 2 0
3 7 2 0
4 5 1 0
4 6 2 0
4 10 1 0
5 11 1 0
6 7 1 0
6 16 1 0
8 12 1 0
8 17 1 1
9 13 1 0
10 14 2 0
11 15 2 0
12 13 1 0
14 15 1 0
18 23 1 0
19 23 1 0
20 23 1 0
21 24 2 0
22 24 1 0
23 24 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 226.32Molecular Weight (Monoisotopic): 226.1470AlogP: 3.53#Rotatable Bonds: 1Polar Surface Area: 16.13Molecular Species: NEUTRALHBA: 2HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 2HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.58CX LogP: 4.17CX LogD: 4.11Aromatic Rings: 2Heavy Atoms: 17QED Weighted: 0.74Np Likeness Score: -1.14
References 1. PubChem BioAssay data set,