The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID103076594 ID: ALA1905589
PubChem CID: 49791278
Max Phase: Preclinical
Molecular Formula: C27H26N4O4
Molecular Weight: 470.53
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2cnc3c(NC(C)=O)cc(-c4ccc(C(=O)NC5CC5)cc4)cn23)cc1OC
Standard InChI: InChI=1S/C27H26N4O4/c1-16(32)29-22-12-20(17-4-6-18(7-5-17)27(33)30-21-9-10-21)15-31-23(14-28-26(22)31)19-8-11-24(34-2)25(13-19)35-3/h4-8,11-15,21H,9-10H2,1-3H3,(H,29,32)(H,30,33)
Standard InChI Key: KOKKUERBWNDANJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
-2.1712 -3.2386 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.7852 -3.5817 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6953 1.8742 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0205 -1.4258 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.9808 -0.1883 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7654 0.8917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2663 1.8742 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3060 -2.6633 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9808 0.6367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7654 -0.4432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2663 1.0492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5518 -0.1883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0204 -1.2278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2663 -0.6008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2503 0.2242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5518 0.6367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1626 -0.6008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4683 -1.8409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8273 -1.3994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7233 -2.6256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5302 -2.7971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8771 -0.1883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1626 -1.4258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0823 -2.1840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5916 -1.4258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9808 2.2867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5916 -0.6008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8771 -1.8383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3060 -1.8383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0205 -3.0758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8455 -3.0758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4330 -3.7902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9808 3.1117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4262 -4.0233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2331 -4.1948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 20 1 0
1 34 1 0
2 21 1 0
2 35 1 0
3 26 2 0
4 29 2 0
5 9 1 0
5 10 1 0
5 14 1 0
6 9 2 0
6 15 1 0
7 11 1 0
7 26 1 0
8 29 1 0
8 30 1 0
9 11 1 0
10 13 1 0
10 15 2 0
11 16 2 0
12 14 2 0
12 16 1 0
12 17 1 0
13 18 1 0
13 19 2 0
17 22 2 0
17 23 1 0
18 20 2 0
19 24 1 0
20 21 1 0
21 24 2 0
22 27 1 0
23 28 2 0
25 27 2 0
25 28 1 0
25 29 1 0
26 33 1 0
30 31 1 0
30 32 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 470.53Molecular Weight (Monoisotopic): 470.1954AlogP: 4.54#Rotatable Bonds: 7Polar Surface Area: 93.96Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.54CX Basic pKa: 5.29CX LogP: 2.44CX LogD: 2.43Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.41Np Likeness Score: -0.99
References 1. PubChem BioAssay data set,