The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-[(2,2-Dimethyl-cyclopropanecarbonyl)-amino]-8-(1-methyl-1-phosphono-ethylamino)-oct-2-enoic acid ID: ALA1907818
PubChem CID: 57400121
Max Phase: Preclinical
Molecular Formula: C17H31N2O6P
Molecular Weight: 390.42
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1(C)C[C@@H]1C(=O)N/C(=C\CCCCCNC(C)(C)P(=O)(O)O)C(=O)O
Standard InChI: InChI=1S/C17H31N2O6P/c1-16(2)11-12(16)14(20)19-13(15(21)22)9-7-5-6-8-10-18-17(3,4)26(23,24)25/h9,12,18H,5-8,10-11H2,1-4H3,(H,19,20)(H,21,22)(H2,23,24,25)/b13-9-/t12-/m1/s1
Standard InChI Key: QXBNNRXWIGCNPK-FNWMBBJUSA-N
Molfile:
RDKit 2D
27 27 0 0 0 0 0 0 0 0999 V2000
5.7712 -3.0274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7921 -3.8447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7881 -5.2834 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
6.4968 -3.4152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3334 -2.3185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5078 -2.3435 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0699 -1.6388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8006 -4.5786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4577 -0.9257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6138 -5.2834 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7212 -1.6055 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0282 -0.2169 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2526 -1.6638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0292 -5.2959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3711 -5.9964 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4003 -3.8572 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2834 -0.9007 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9914 -3.6321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5711 -4.6454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4720 -4.2826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0250 -4.5786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8648 -2.3769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4253 -3.8447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0558 -2.3936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8299 -3.1275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6555 -3.1150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2814 -2.3791 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 8 1 0
4 1 1 0
1 5 1 1
6 5 1 0
7 6 1 0
8 16 1 0
9 7 1 0
10 3 2 0
11 5 2 0
12 9 2 0
13 7 2 0
14 3 1 0
15 3 1 0
16 23 1 0
17 9 1 0
18 2 1 0
19 2 1 0
20 8 1 0
21 8 1 0
22 13 1 0
23 25 1 0
24 22 1 0
25 26 1 0
26 24 1 0
2 4 1 0
1 27 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 390.42Molecular Weight (Monoisotopic): 390.1920AlogP: 2.18#Rotatable Bonds: 11Polar Surface Area: 135.96Molecular Species: ZWITTERIONHBA: 4HBD: 5#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: -0.67CX Basic pKa: 9.42CX LogP: -0.36CX LogD: -4.15Aromatic Rings: ┄Heavy Atoms: 26QED Weighted: 0.21Np Likeness Score: 0.65
References 1. Graham DW, Ashton WT, Barash L, Brown JE, Brown RD, Canning LF, Chen A, Springer JP, Rogers EF.. (1987) Inhibition of the mammalian beta-lactamase renal dipeptidase (dehydropeptidase-I) by (Z)-2-(acylamino)-3-substituted-propenoic acids., 30 (6): [PMID:3495664 ] [10.1021/jm00389a018 ]