The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-[(2,2-Dimethyl-cyclopropanecarbonyl)-amino]-8-(1-phosphono-ethylamino)-oct-2-enoic acid ID: ALA1907822
PubChem CID: 57400993
Max Phase: Preclinical
Molecular Formula: C16H29N2O6P
Molecular Weight: 376.39
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(NCCCCC/C=C(\NC(=O)[C@H]1CC1(C)C)C(=O)O)P(=O)(O)O
Standard InChI: InChI=1S/C16H29N2O6P/c1-11(25(22,23)24)17-9-7-5-4-6-8-13(15(20)21)18-14(19)12-10-16(12,2)3/h8,11-12,17H,4-7,9-10H2,1-3H3,(H,18,19)(H,20,21)(H2,22,23,24)/b13-8-/t11?,12-/m1/s1
Standard InChI Key: JGWBZZGFKONACH-KZPJGYJXSA-N
Molfile:
RDKit 2D
26 26 0 0 0 0 0 0 0 0999 V2000
5.7820 -3.0330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8028 -3.8519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5089 -3.4215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7896 -5.2932 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
5.3433 -2.3228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5161 -2.3479 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0775 -1.6418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4660 -0.9274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8021 -4.5871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6168 -5.2932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7318 -1.6084 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0357 -0.2173 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2586 -1.6669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0293 -5.3057 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3718 -6.0076 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4011 -3.8644 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2932 -0.9024 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0007 -3.6388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5814 -4.6540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4747 -4.2905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8701 -2.3813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4261 -3.8519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0596 -2.3980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8314 -3.1333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6586 -3.1207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2922 -2.3846 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 9 1 0
1 5 1 1
6 5 1 0
7 6 1 0
8 7 1 0
9 16 1 0
10 4 2 0
11 5 2 0
12 8 2 0
13 7 2 0
14 4 1 0
15 4 1 0
16 22 1 0
17 8 1 0
18 2 1 0
19 2 1 0
20 9 1 0
21 13 1 0
22 24 1 0
23 21 1 0
24 25 1 0
25 23 1 0
2 3 1 0
1 26 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 376.39Molecular Weight (Monoisotopic): 376.1763AlogP: 1.79#Rotatable Bonds: 11Polar Surface Area: 135.96Molecular Species: ZWITTERIONHBA: 4HBD: 5#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: -0.63CX Basic pKa: 9.33CX LogP: -0.90CX LogD: -4.66Aromatic Rings: ┄Heavy Atoms: 25QED Weighted: 0.21Np Likeness Score: 0.72
References 1. Graham DW, Ashton WT, Barash L, Brown JE, Brown RD, Canning LF, Chen A, Springer JP, Rogers EF.. (1987) Inhibition of the mammalian beta-lactamase renal dipeptidase (dehydropeptidase-I) by (Z)-2-(acylamino)-3-substituted-propenoic acids., 30 (6): [PMID:3495664 ] [10.1021/jm00389a018 ]