The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R) 2-[3-(2,6-Diisopropyl-phenyl)-ureido]-3-(1H-indol-3-yl)-2-methyl-N-(1,2,3,4-tetrahydro-naphthalen-1-yl)-propionamide ID: ALA1907865
PubChem CID: 57402754
Max Phase: Preclinical
Molecular Formula: C35H42N4O2
Molecular Weight: 550.75
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)c1cccc(C(C)C)c1NC(=O)N[C@](C)(Cc1c[nH]c2ccccc12)C(=O)NC1CCCc2ccccc21
Standard InChI: InChI=1S/C35H42N4O2/c1-22(2)26-16-11-17-27(23(3)4)32(26)38-34(41)39-35(5,20-25-21-36-30-18-9-8-15-29(25)30)33(40)37-31-19-10-13-24-12-6-7-14-28(24)31/h6-9,11-12,14-18,21-23,31,36H,10,13,19-20H2,1-5H3,(H,37,40)(H2,38,39,41)/t31?,35-/m1/s1
Standard InChI Key: BCUIXRZIPCRVGV-NOUYKBLCSA-N
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
-1.7514 -1.4178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8306 -0.1793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1051 -1.4178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8264 -1.8306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3211 -1.4178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0341 -1.8306 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8264 -2.6563 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1399 0.0959 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5395 -0.5880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3920 -1.8306 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7514 -0.5922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4727 -1.8306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1134 -0.5922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5437 -3.0649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9182 0.6463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2525 -2.6438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7188 0.8089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3211 -0.5922 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5395 -1.4136 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9656 -3.0566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0383 -0.1751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4727 -2.6563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1051 -2.2434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1858 -1.4178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4727 -0.1793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5395 -3.8905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1858 -0.5922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3761 1.2510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2525 -4.2950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2525 -1.8264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9656 -3.8822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9815 1.5887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6828 -2.6521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9633 0.5337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2752 -0.1251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1858 -3.0691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7514 -3.0691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9656 -1.4136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6263 2.0349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4311 2.2100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6828 -1.8264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 13 1 0
3 10 1 6
4 3 1 0
5 6 1 0
6 1 1 0
7 4 1 0
8 9 1 0
9 2 2 0
10 5 1 0
11 1 1 0
12 1 2 0
13 3 1 0
14 7 1 0
15 2 1 0
16 14 1 0
17 15 2 0
18 5 2 0
19 4 2 0
20 16 2 0
21 11 1 0
22 12 1 0
3 23 1 1
24 12 1 0
25 11 2 0
26 14 1 0
27 24 2 0
28 15 1 0
29 26 1 0
30 16 1 0
31 29 1 0
32 17 1 0
33 20 1 0
34 21 1 0
35 21 1 0
36 22 1 0
37 22 1 0
38 30 2 0
39 28 2 0
40 39 1 0
41 38 1 0
25 27 1 0
8 17 1 0
32 40 2 0
20 31 1 0
33 41 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 550.75Molecular Weight (Monoisotopic): 550.3308AlogP: 7.73#Rotatable Bonds: 8Polar Surface Area: 86.02Molecular Species: NEUTRALHBA: 2HBD: 4#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.39CX Basic pKa: ┄CX LogP: 7.96CX LogD: 7.96Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.18Np Likeness Score: -0.50
References 1. Eden J, Hall M, Higginbottom M, Horwell D, Howson W, Hughes J, Jordan R, Lewthwaite R, Martin K, McKnight A, O'Toole J, Pinnock R, Pritchard M, Suman-Chauhan N, Williams S. (1996) PD 165929 the first high affinity non-peptide neuromedin-B (NMB) receptor selective antagonist, 6 (21): [10.1016/0960-894X(96)00481-7 ]