The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
18-Vinylprogesterone (18-VP) ID: ALA1908235
PubChem CID: 9862789
Max Phase: Preclinical
Molecular Formula: C23H32O2
Molecular Weight: 340.51
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: 18-Vinylprogesterone | 18-Vinylprogesterone|SCHEMBL4154960|CHEMBL1908235|(8S,9S,10R,13R,14S,17S)-17-acetyl-10-methyl-13-prop-2-enyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one
Canonical SMILES: C=CC[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@@H]2C(C)=O
Standard InChI: InChI=1S/C23H32O2/c1-4-11-23-13-10-20-18(21(23)8-7-19(23)15(2)24)6-5-16-14-17(25)9-12-22(16,20)3/h4,14,18-21H,1,5-13H2,2-3H3/t18-,19-,20+,21+,22+,23-/m1/s1
Standard InChI Key: TZDPJVSOAZDLGP-NURQPWONSA-N
Molfile:
RDKit 2D
28 31 0 0 0 0 0 0 0 0999 V2000
-3.6536 13.5241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9391 13.9366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9391 14.7616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6536 15.1741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3680 14.7616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3680 13.9366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2246 15.1741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5101 14.7616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5101 13.9366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2246 13.5241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2247 15.9991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5102 16.4117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7957 15.9992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7957 15.1742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0111 14.9193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4738 15.5867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0111 16.2541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2438 17.0387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3082 17.6518 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0508 17.2103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7957 16.8242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5102 17.2367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5102 18.0617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9391 15.5866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0825 13.5241 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5101 15.5866 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.2246 14.3491 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.7957 14.3492 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
3 4 1 0
4 5 1 0
5 6 1 0
6 1 1 0
10 2 1 0
2 3 1 0
3 7 1 0
8 9 1 0
9 10 1 0
14 8 1 0
8 7 1 0
7 11 1 0
11 12 1 0
12 13 1 0
13 17 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 1
18 19 2 0
18 20 1 0
13 21 1 1
21 22 1 0
22 23 2 0
3 24 1 1
6 25 2 0
8 26 1 1
7 27 1 6
14 28 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 340.51Molecular Weight (Monoisotopic): 340.2402AlogP: 5.28#Rotatable Bonds: 3Polar Surface Area: 34.14Molecular Species: NEUTRALHBA: 2HBD: ┄#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.73CX LogD: 4.73Aromatic Rings: ┄Heavy Atoms: 25QED Weighted: 0.66Np Likeness Score: 2.33
References 1. Fontana E, Dansette PM, Poli SM.. (2005) Cytochrome p450 enzymes mechanism based inhibitors: common sub-structures and reactivity., 6 (1): [PMID:16248836 ] [10.2174/138920005774330639 ]