The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-tert-Butyl-3-[7-(4-diethylamino-butylamino)-3-(3,5-dimethoxy-phenyl)-[1,6]naphthyridin-2-yl]-urea ID: ALA191023
PubChem CID: 5330133
Max Phase: Preclinical
Molecular Formula: C29H42N6O3
Molecular Weight: 522.69
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)CCCCNc1cc2nc(NC(=O)NC(C)(C)C)c(-c3cc(OC)cc(OC)c3)cc2cn1
Standard InChI: InChI=1S/C29H42N6O3/c1-8-35(9-2)13-11-10-12-30-26-18-25-21(19-31-26)16-24(20-14-22(37-6)17-23(15-20)38-7)27(32-25)33-28(36)34-29(3,4)5/h14-19H,8-13H2,1-7H3,(H,30,31)(H2,32,33,34,36)
Standard InChI Key: YMKCMNJQFGEWCA-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 40 0 0 0 0 0 0 0 0999 V2000
1.9250 0.0083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6167 -0.4042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2292 -0.3917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9250 0.8083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6167 -1.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6167 1.2083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5417 0.0083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2292 1.2083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5417 0.8083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1458 -0.3917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8333 0.8083 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8333 0.0083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3042 -1.6125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6167 2.0208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3042 0.8083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1458 1.2083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9292 -1.6042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9917 2.0208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3042 2.4208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9917 1.2083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3042 -2.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5250 -0.4042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.1500 -3.6125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3042 3.2208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6875 0.8000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5750 -2.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1292 -2.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2167 -3.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5792 -3.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7875 -4.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1500 -2.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5208 -1.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6792 -0.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9875 3.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8333 -2.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8333 -1.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6792 -4.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6958 -4.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 2 0
4 1 1 0
5 2 1 0
6 4 1 0
7 3 1 0
8 4 2 0
9 8 1 0
10 7 2 0
11 16 1 0
12 10 1 0
13 5 1 0
14 6 1 0
15 6 2 0
16 9 2 0
17 5 2 0
18 20 2 0
19 14 2 0
20 15 1 0
21 13 1 0
22 12 1 0
23 31 1 0
24 19 1 0
25 20 1 0
26 21 1 0
27 21 1 0
28 21 1 0
29 23 1 0
30 23 1 0
31 35 1 0
32 22 1 0
33 25 1 0
34 24 1 0
35 36 1 0
36 32 1 0
37 29 1 0
38 30 1 0
9 7 1 0
18 19 1 0
11 12 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 522.69Molecular Weight (Monoisotopic): 522.3318AlogP: 5.77#Rotatable Bonds: 12Polar Surface Area: 100.64Molecular Species: BASEHBA: 7HBD: 3#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.59CX Basic pKa: 10.30CX LogP: 4.22CX LogD: 1.57Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.26Np Likeness Score: -1.02
References 1. Thompson AM, Delaney AM, Hamby JM, Schroeder MC, Spoon TA, Crean SM, Showalter HD, Denny WA.. (2005) Synthesis and structure-activity relationships of soluble 7-substituted 3-(3,5-dimethoxyphenyl)-1,6-naphthyridin-2-amines and related ureas as dual inhibitors of the fibroblast growth factor receptor-1 and vascular endothelial growth factor receptor-2 tyrosine kinases., 48 (14): [PMID:16000000 ] [10.1021/jm0500931 ]