4-nitro-2-[(4-phenyl-6-p-tolyl-pyrimidin-2-yl)-hydrazonomethyl]-phenol

ID: ALA1911378

PubChem CID: 135443155

Max Phase: Preclinical

Molecular Formula: C24H19N5O3

Molecular Weight: 425.45

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(-c2cc(-c3ccccc3)nc(N/N=C/c3cc([N+](=O)[O-])ccc3O)n2)cc1

Standard InChI:  InChI=1S/C24H19N5O3/c1-16-7-9-18(10-8-16)22-14-21(17-5-3-2-4-6-17)26-24(27-22)28-25-15-19-13-20(29(31)32)11-12-23(19)30/h2-15,30H,1H3,(H,26,27,28)/b25-15+

Standard InChI Key:  UGVZCUFTNQCSKG-MFKUBSTISA-N

Molfile:  

     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   14.2486   -2.4083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2474   -3.2357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9622   -3.6485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6787   -3.2352    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.6758   -2.4047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9604   -1.9955    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.5361   -1.9961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5372   -1.1700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8235   -0.7578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1082   -1.1705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1110   -1.9998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8253   -2.4083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9639   -4.4713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2477   -4.8831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2472   -5.7073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9621   -6.1208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6790   -5.7040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6760   -4.8812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9630   -6.9458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3887   -1.9895    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.3856   -1.1645    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.6696   -0.7547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6665    0.0703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3812    0.4835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3784    1.3078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6619    1.7184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9466    1.2988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9529    0.4759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2414    0.0583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.0941    1.7271    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.0914    2.5521    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.8099    1.3170    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 15 16  2  0
 16 17  1  0
  8  9  1  0
 17 18  2  0
 18 13  1  0
  3 13  1  0
  4  5  1  0
 16 19  1  0
  9 10  2  0
  5 20  1  0
  2  3  1  0
 20 21  1  0
 10 11  1  0
 21 22  2  0
  5  6  2  0
 22 23  1  0
 11 12  2  0
 23 24  2  0
 12  7  1  0
 24 25  1  0
  1  7  1  0
 25 26  2  0
  6  1  1  0
 26 27  1  0
  1  2  2  0
 27 28  2  0
 28 23  1  0
 13 14  2  0
 28 29  1  0
  3  4  2  0
 14 15  1  0
  7  8  2  0
 30 31  2  0
 30 32  1  0
 25 30  1  0
M  CHG  2  30   1  32  -1
M  END

Alternative Forms

  1. Parent:

    ALA1911378

    ---

Associated Targets(Human)

SFN Tbio 14-3-3 protein sigma (29 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Sfn 14-3-3 protein sigma (1 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 425.45Molecular Weight (Monoisotopic): 425.1488AlogP: 5.18#Rotatable Bonds: 6
Polar Surface Area: 113.54Molecular Species: ACIDHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 6.40CX Basic pKa: 3.54CX LogP: 6.77CX LogD: 5.76
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.25Np Likeness Score: -1.32

References

1. Corradi V, Mancini M, Santucci MA, Carlomagno T, Sanfelice D, Mori M, Vignaroli G, Falchi F, Manetti F, Radi M, Botta M..  (2011)  Computational techniques are valuable tools for the discovery of protein-protein interaction inhibitors: the 14-3-3σ case.,  21  (22): [PMID:21962576] [10.1016/j.bmcl.2011.09.011]

Source