The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-nitro-2-[(4-phenyl-6-p-tolyl-pyrimidin-2-yl)-hydrazonomethyl]-phenol ID: ALA1911378
PubChem CID: 135443155
Max Phase: Preclinical
Molecular Formula: C24H19N5O3
Molecular Weight: 425.45
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(-c2cc(-c3ccccc3)nc(N/N=C/c3cc([N+](=O)[O-])ccc3O)n2)cc1
Standard InChI: InChI=1S/C24H19N5O3/c1-16-7-9-18(10-8-16)22-14-21(17-5-3-2-4-6-17)26-24(27-22)28-25-15-19-13-20(29(31)32)11-12-23(19)30/h2-15,30H,1H3,(H,26,27,28)/b25-15+
Standard InChI Key: UGVZCUFTNQCSKG-MFKUBSTISA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
14.2486 -2.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2474 -3.2357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9622 -3.6485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6787 -3.2352 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.6758 -2.4047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9604 -1.9955 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.5361 -1.9961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5372 -1.1700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8235 -0.7578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1082 -1.1705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1110 -1.9998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8253 -2.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9639 -4.4713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2477 -4.8831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2472 -5.7073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9621 -6.1208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6790 -5.7040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6760 -4.8812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9630 -6.9458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3887 -1.9895 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.3856 -1.1645 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.6696 -0.7547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6665 0.0703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3812 0.4835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3784 1.3078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6619 1.7184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9466 1.2988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9529 0.4759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2414 0.0583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.0941 1.7271 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.0914 2.5521 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.8099 1.3170 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15 16 2 0
16 17 1 0
8 9 1 0
17 18 2 0
18 13 1 0
3 13 1 0
4 5 1 0
16 19 1 0
9 10 2 0
5 20 1 0
2 3 1 0
20 21 1 0
10 11 1 0
21 22 2 0
5 6 2 0
22 23 1 0
11 12 2 0
23 24 2 0
12 7 1 0
24 25 1 0
1 7 1 0
25 26 2 0
6 1 1 0
26 27 1 0
1 2 2 0
27 28 2 0
28 23 1 0
13 14 2 0
28 29 1 0
3 4 2 0
14 15 1 0
7 8 2 0
30 31 2 0
30 32 1 0
25 30 1 0
M CHG 2 30 1 32 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 425.45Molecular Weight (Monoisotopic): 425.1488AlogP: 5.18#Rotatable Bonds: 6Polar Surface Area: 113.54Molecular Species: ACIDHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 6.40CX Basic pKa: 3.54CX LogP: 6.77CX LogD: 5.76Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.25Np Likeness Score: -1.32
References 1. Corradi V, Mancini M, Santucci MA, Carlomagno T, Sanfelice D, Mori M, Vignaroli G, Falchi F, Manetti F, Radi M, Botta M.. (2011) Computational techniques are valuable tools for the discovery of protein-protein interaction inhibitors: the 14-3-3σ case., 21 (22): [PMID:21962576 ] [10.1016/j.bmcl.2011.09.011 ]