The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(3-(1-((6-(2-chloro-4-(methylsulfonamido)phenoxy)-2-methylpyridin-3-yl)methyl)piperidin-4-yl)-3-(3-fluorophenyl)ureido)picolinamide ID: ALA1914528
PubChem CID: 57403352
Max Phase: Preclinical
Molecular Formula: C32H33ClFN7O5S
Molecular Weight: 682.18
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nc(Oc2ccc(NS(C)(=O)=O)cc2Cl)ccc1CN1CCC(N(C(=O)Nc2ccc(C(N)=O)nc2)c2cccc(F)c2)CC1
Standard InChI: InChI=1S/C32H33ClFN7O5S/c1-20-21(6-11-30(37-20)46-29-10-8-23(17-27(29)33)39-47(2,44)45)19-40-14-12-25(13-15-40)41(26-5-3-4-22(34)16-26)32(43)38-24-7-9-28(31(35)42)36-18-24/h3-11,16-18,25,39H,12-15,19H2,1-2H3,(H2,35,42)(H,38,43)
Standard InChI Key: WMHUXCUGXVXAJP-UHFFFAOYSA-N
Molfile:
RDKit 2D
47 51 0 0 0 0 0 0 0 0999 V2000
-4.3042 -18.6375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.7125 -17.9250 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-5.1254 -18.6349 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2806 -17.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2818 -18.7523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5669 -19.1652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8505 -18.7519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8534 -17.9213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5687 -17.5122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1354 -19.1632 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4216 -18.7496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2902 -19.1614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0035 -18.7485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0027 -17.9226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2825 -17.5114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4278 -17.9267 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7160 -17.5080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4316 -17.9185 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4293 -18.7470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1409 -19.1574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8566 -18.7463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8562 -17.9203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1401 -17.5054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5707 -19.1594 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5700 -19.9844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2856 -18.7476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9997 -19.1607 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2863 -17.9226 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7145 -18.7488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4246 -19.1651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1389 -18.7540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1401 -17.9281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4209 -17.5151 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7095 -17.9287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8544 -17.5153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9952 -17.5126 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.4241 -17.5130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8542 -20.3946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8531 -21.2188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5678 -21.6328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2850 -21.2165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2825 -20.3936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5690 -17.9274 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8540 -16.6903 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2783 -16.6864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1381 -21.6304 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.5671 -19.9902 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
22 23 1 0
11 12 2 0
21 24 1 0
6 7 2 0
24 25 1 0
12 13 1 0
24 26 1 0
2 1 2 0
26 27 1 0
13 14 2 0
26 28 2 0
7 8 1 0
27 29 1 0
14 15 1 0
29 30 2 0
4 5 2 0
30 31 1 0
15 16 2 0
31 32 2 0
16 11 1 0
32 33 1 0
8 9 2 0
33 34 2 0
34 29 1 0
14 17 1 0
32 35 1 0
9 4 1 0
4 36 1 0
36 2 1 0
17 18 1 0
2 37 1 0
18 19 1 0
25 38 2 0
3 2 2 0
38 39 1 0
7 10 1 0
39 40 2 0
5 6 1 0
40 41 1 0
10 11 1 0
41 42 2 0
42 25 1 0
35 43 1 0
18 23 1 0
35 44 2 0
19 20 1 0
15 45 1 0
20 21 1 0
39 46 1 0
21 22 1 0
6 47 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 682.18Molecular Weight (Monoisotopic): 681.1936AlogP: 5.54#Rotatable Bonds: 10Polar Surface Area: 159.85Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 4#RO5 Violations (Lipinski): 3CX Acidic pKa: 9.70CX Basic pKa: 7.44CX LogP: 2.88CX LogD: 2.56Aromatic Rings: 4Heavy Atoms: 47QED Weighted: 0.20Np Likeness Score: -1.86
References 1. Duan M, Kazmierski WM, Chong PY, Deanda F, Edelstein M, Ferris R, Peckham J, Wheelan P, Xiong Z, Zhang H, Nishizawa R, Takaoka Y.. (2011) Discovery of novel pyridyl carboxamides as potent CCR5 antagonists and optimization of their pharmacokinetic profile in rats., 21 (21): [PMID:21920742 ] [10.1016/j.bmcl.2011.08.080 ]