The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
rac-1-(2-(2-hydroxy-3-(4-p-tolylpiperazin-1-yl)propoxy)phenyl)-3-phenylpropan-1-one hydrochloride ID: ALA1914844
PubChem CID: 56647654
Max Phase: Preclinical
Molecular Formula: C29H35ClN2O3
Molecular Weight: 458.60
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(N2CCN(CC(O)COc3ccccc3C(=O)CCc3ccccc3)CC2)cc1.Cl
Standard InChI: InChI=1S/C29H34N2O3.ClH/c1-23-11-14-25(15-12-23)31-19-17-30(18-20-31)21-26(32)22-34-29-10-6-5-9-27(29)28(33)16-13-24-7-3-2-4-8-24;/h2-12,14-15,26,32H,13,16-22H2,1H3;1H
Standard InChI Key: JVZSQIMZZQMQGM-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
16.3500 -6.0625 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
8.1527 -6.6416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1516 -7.4690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8664 -7.8819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5828 -7.4685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5800 -6.6380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8646 -6.2289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2929 -6.2228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0089 -6.6326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2898 -5.3978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7218 -6.2174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4378 -6.6272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4378 -7.4511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1530 -7.8608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8669 -7.4456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8611 -6.6163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1454 -6.2103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2980 -7.8799 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2992 -8.7049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0144 -9.1163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0157 -9.9413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7282 -8.7027 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7308 -10.3527 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.7283 -11.1757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4393 -11.5870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1556 -11.1769 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.1563 -10.3509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4407 -9.9351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8692 -11.5910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8621 -12.4136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5748 -12.8276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2912 -12.4166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2903 -11.5873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5770 -11.1771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0053 -12.8297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8 9 1 0
5 18 1 0
18 19 1 0
8 10 2 0
19 20 1 0
5 6 1 0
20 21 1 0
9 11 1 0
20 22 1 0
3 4 1 0
21 23 1 0
23 24 1 0
11 12 1 0
6 7 2 0
12 13 2 0
7 2 1 0
13 14 1 0
23 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
2 3 2 0
26 29 1 0
14 15 2 0
29 30 2 0
6 8 1 0
30 31 1 0
15 16 1 0
31 32 2 0
4 5 2 0
32 33 1 0
16 17 2 0
33 34 2 0
34 29 1 0
17 12 1 0
32 35 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 458.60Molecular Weight (Monoisotopic): 458.2569AlogP: 4.37#Rotatable Bonds: 10Polar Surface Area: 53.01Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.80CX LogP: 5.29CX LogD: 5.20Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.46Np Likeness Score: -0.97
References 1. Lowes DJ, Guiguemde WA, Connelly MC, Zhu F, Sigal MS, Clark JA, Lemoff AS, Derisi JL, Wilson EB, Guy RK.. (2011) Optimization of propafenone analogues as antimalarial leads., 54 (21): [PMID:21955244 ] [10.1021/jm2005546 ]