The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-O-Eicosapentaenoyloxy-1,4-naphthoquinone ID: ALA1917201
PubChem CID: 57392097
Max Phase: Preclinical
Molecular Formula: C30H34O4
Molecular Weight: 458.60
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)Oc1cccc2c1C(=O)C=CC2=O
Standard InChI: InChI=1S/C30H34O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-29(33)34-28-21-19-20-25-26(31)23-24-27(32)30(25)28/h3-4,6-7,9-10,12-13,15-16,19-21,23-24H,2,5,8,11,14,17-18,22H2,1H3/b4-3-,7-6-,10-9-,13-12-,16-15-
Standard InChI Key: KVQGLINVYSESIA-JLNKQSITSA-N
Molfile:
RDKit 2D
34 35 0 0 0 0 0 0 0 0999 V2000
1.3002 -7.2195 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3129 -8.0444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6048 -8.4678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6175 -9.2927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0905 -9.7162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0778 -10.5411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7859 -10.9645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5066 -10.5630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2147 -10.9865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9354 -10.5850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9481 -9.7601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6688 -9.3586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6815 -8.5337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9734 -8.1103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9861 -7.2854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0336 -8.4458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.2781 -6.8620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5574 -7.2634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8493 -6.8400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1286 -7.2414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1159 -8.0663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8239 -8.4898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4667 -9.2583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1792 -9.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4667 -10.9208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7542 -9.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1792 -10.5083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7542 -10.5083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4667 -8.4333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4625 -11.7458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0375 -9.2708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0417 -10.9208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3292 -9.6833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3250 -10.5083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8 9 1 0
17 18 1 0
4 5 1 0
18 19 1 0
9 10 2 0
19 20 2 0
2 3 1 0
20 21 1 0
10 11 1 0
21 22 1 0
5 6 1 0
11 12 1 0
1 2 2 0
12 13 2 0
6 7 2 0
13 14 1 0
3 4 1 0
14 15 1 0
7 8 1 0
2 16 1 0
15 17 2 0
24 23 1 0
25 28 1 0
26 23 1 0
27 24 2 0
28 26 1 0
29 23 2 0
30 25 2 0
31 26 2 0
32 28 2 0
33 31 1 0
34 33 2 0
27 25 1 0
32 34 1 0
31 16 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 458.60Molecular Weight (Monoisotopic): 458.2457AlogP: 7.45#Rotatable Bonds: 14Polar Surface Area: 60.44Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 7.55CX LogD: 7.55Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.13Np Likeness Score: 0.94
References 1. Maruo S, Kuriyama I, Kuramochi K, Tsubaki K, Yoshida H, Mizushina Y.. (2011) Inhibitory effect of novel 5-O-acyl juglones on mammalian DNA polymerase activity, cancer cell growth and inflammatory response., 19 (19): [PMID:21903399 ] [10.1016/j.bmc.2011.08.023 ]