The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-O-Docosahexaenoyloxy-1,4-naphthoquinone ID: ALA1917202
PubChem CID: 57399073
Max Phase: Preclinical
Molecular Formula: C32H36O4
Molecular Weight: 484.64
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)Oc1cccc2c1C(=O)C=CC2=O
Standard InChI: InChI=1S/C32H36O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-31(35)36-30-23-21-22-27-28(33)25-26-29(34)32(27)30/h3-4,6-7,9-10,12-13,15-16,18-19,21-23,25-26H,2,5,8,11,14,17,20,24H2,1H3/b4-3-,7-6-,10-9-,13-12-,16-15-,19-18-
Standard InChI Key: GOBRTYYODLWLHJ-KUBAVDMBSA-N
Molfile:
RDKit 2D
36 37 0 0 0 0 0 0 0 0999 V2000
10.5379 -9.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8235 -9.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1090 -9.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3945 -9.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6801 -9.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6801 -8.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9656 -8.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9656 -7.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6801 -6.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6801 -5.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3945 -5.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1090 -5.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8235 -5.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5379 -5.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5379 -6.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2524 -7.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2524 -9.6667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5379 -8.4292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9669 -6.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9669 -5.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6814 -5.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3958 -5.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3958 -6.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1103 -7.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6833 -10.4792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3958 -10.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6833 -12.1417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9708 -10.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3958 -11.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9708 -11.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6833 -9.6542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6792 -12.9667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2542 -10.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2583 -12.1417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5458 -10.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5417 -11.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 5 2 0
16 19 2 0
9 10 1 0
19 20 1 0
2 3 1 0
20 21 1 0
10 11 2 0
21 22 2 0
5 6 1 0
22 23 1 0
11 12 1 0
23 24 1 0
1 2 1 0
12 13 1 0
6 7 1 0
13 14 2 0
3 4 1 0
14 15 1 0
7 8 2 0
15 16 1 0
1 17 1 0
8 9 1 0
1 18 2 0
26 25 1 0
27 30 1 0
28 25 1 0
29 26 2 0
30 28 1 0
31 25 2 0
32 27 2 0
33 28 2 0
34 30 2 0
35 33 1 0
36 35 2 0
29 27 1 0
34 36 1 0
33 17 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 484.64Molecular Weight (Monoisotopic): 484.2614AlogP: 8.01#Rotatable Bonds: 15Polar Surface Area: 60.44Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 8.08CX LogD: 8.08Aromatic Rings: 1Heavy Atoms: 36QED Weighted: 0.14Np Likeness Score: 0.89
References 1. Maruo S, Kuriyama I, Kuramochi K, Tsubaki K, Yoshida H, Mizushina Y.. (2011) Inhibitory effect of novel 5-O-acyl juglones on mammalian DNA polymerase activity, cancer cell growth and inflammatory response., 19 (19): [PMID:21903399 ] [10.1016/j.bmc.2011.08.023 ]