The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,3-Dimethoxy-12-[2-(4-methyl-piperidin-1-yl)-ethyl]-12H-8,10-dioxa-6,12-diaza-cyclopenta[b]chrysen-13-one ID: ALA191909
PubChem CID: 11751876
Max Phase: Preclinical
Molecular Formula: C27H29N3O5
Molecular Weight: 475.55
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(=O)n(CCN3CCC(C)CC3)c3c4cc5c(cc4ncc3c2cc1OC)OCO5
Standard InChI: InChI=1S/C27H29N3O5/c1-16-4-6-29(7-5-16)8-9-30-26-19-12-24-25(35-15-34-24)13-21(19)28-14-20(26)17-10-22(32-2)23(33-3)11-18(17)27(30)31/h10-14,16H,4-9,15H2,1-3H3
Standard InChI Key: WCCVBYZDMZQENR-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 40 0 0 0 0 0 0 0 0999 V2000
-0.1208 -0.1917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.1208 0.6333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8458 -0.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8458 1.0458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5583 0.6333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5583 -0.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5917 1.0458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5917 1.8708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3042 0.6333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2708 1.0458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2708 -0.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1333 2.2833 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8458 1.8708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3042 2.2833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5917 -0.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0167 1.0458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0167 1.8708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9833 0.6333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9833 -0.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3042 -1.8542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8458 -1.4292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8042 0.7958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8042 2.1333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2917 1.4583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5917 -1.4417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3042 -2.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0167 -1.4417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7083 1.0583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.7083 -0.6167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0167 -3.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7375 -1.8542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7375 -2.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4208 -0.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4208 0.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4667 -3.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 2 2 0
5 6 1 0
6 3 1 0
7 2 1 0
8 7 2 0
9 7 1 0
10 5 2 0
11 6 2 0
12 8 1 0
13 4 1 0
14 8 1 0
15 1 1 0
16 9 2 0
17 16 1 0
18 19 2 0
19 11 1 0
20 25 1 0
21 3 2 0
22 16 1 0
23 17 1 0
24 22 1 0
25 15 1 0
26 20 1 0
27 20 1 0
28 18 1 0
29 19 1 0
30 26 1 0
31 27 1 0
32 31 1 0
33 29 1 0
34 28 1 0
35 32 1 0
5 4 1 0
12 13 2 0
18 10 1 0
17 14 2 0
32 30 1 0
24 23 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 475.55Molecular Weight (Monoisotopic): 475.2107AlogP: 4.18#Rotatable Bonds: 5Polar Surface Area: 75.05Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.46CX LogP: 3.22CX LogD: 2.13Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.40Np Likeness Score: -0.54
References 1. Ruchelman AL, Houghton PJ, Zhou N, Liu A, Liu LF, LaVoie EJ.. (2005) 5-(2-aminoethyl)dibenzo[c,h][1,6]naphthyridin-6-ones: variation of n-alkyl substituents modulates sensitivity to efflux transporters associated with multidrug resistance., 48 (3): [PMID:15689163 ] [10.1021/jm049447z ] 2. Zhou W, Dai Z, Chen Y, Yuan Z. (2013) Computational QSAR models with high-dimensional descriptor selection improve antitumor activity design of ARC-111 analogues, 22 (1): [10.1007/s00044-012-0034-x ]