The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-(Trifluoromethoxy)benzyl)-2-(4-(trifluoromethoxy)phenyl)benzimidazole ID: ALA1922088
PubChem CID: 11648120
Max Phase: Preclinical
Molecular Formula: C22H14F6N2O2
Molecular Weight: 452.35
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: FC(F)(F)Oc1ccc(Cn2c(-c3ccc(OC(F)(F)F)cc3)nc3ccccc32)cc1
Standard InChI: InChI=1S/C22H14F6N2O2/c23-21(24,25)31-16-9-5-14(6-10-16)13-30-19-4-2-1-3-18(19)29-20(30)15-7-11-17(12-8-15)32-22(26,27)28/h1-12H,13H2
Standard InChI Key: USFLLYIPZKRUAK-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
15.1569 -2.6625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1557 -3.4898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8706 -3.9027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8688 -2.2497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5841 -2.6588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5844 -3.4899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3745 -3.7477 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.8632 -3.0740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3744 -2.4018 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.6882 -3.0737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0971 -3.7882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9213 -3.7883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3344 -3.0731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9172 -2.3564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0943 -2.3599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3713 -4.5679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0913 -4.9707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1007 -5.7941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8198 -6.1968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5296 -5.7746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5157 -4.9455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7960 -4.5465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2502 -6.1764 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.1594 -3.0717 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.5731 -3.7855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3981 -3.7841 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.1618 -4.5007 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.9792 -4.4958 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
20.2625 -7.0013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9830 -7.4031 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
19.5542 -7.4244 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
20.2542 -7.8250 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15 10 1 0
5 4 2 0
7 16 1 0
6 7 1 0
16 17 1 0
7 8 1 0
17 18 2 0
8 9 2 0
18 19 1 0
9 5 1 0
19 20 2 0
4 1 1 0
20 21 1 0
8 10 1 0
21 22 2 0
22 17 1 0
5 6 1 0
20 23 1 0
10 11 2 0
13 24 1 0
24 25 1 0
11 12 1 0
25 26 1 0
2 3 1 0
25 27 1 0
12 13 2 0
25 28 1 0
3 6 2 0
23 29 1 0
13 14 1 0
29 30 1 0
1 2 2 0
29 31 1 0
14 15 2 0
29 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 452.35Molecular Weight (Monoisotopic): 452.0959AlogP: 6.55#Rotatable Bonds: 5Polar Surface Area: 36.28Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 4.74CX LogP: 8.09CX LogD: 8.09Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.32Np Likeness Score: -1.12
References 1. Bandyopadhyay P, Sathe M, Ponmariappan S, Sharma A, Sharma P, Srivastava AK, Kaushik MP.. (2011) Exploration of in vitro time point quantitative evaluation of newly synthesized benzimidazole and benzothiazole derivatives as potential antibacterial agents., 21 (24): [PMID:22047695 ] [10.1016/j.bmcl.2011.10.034 ]