The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S,E)-Methyl 3-(3-(6-bromopyridin-2-yl)-2-cyanoacrylamido)-3-phenylpropanoate ID: ALA1923247
PubChem CID: 57401278
Max Phase: Preclinical
Molecular Formula: C19H16BrN3O3
Molecular Weight: 414.26
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)C[C@H](NC(=O)/C(C#N)=C/c1cccc(Br)n1)c1ccccc1
Standard InChI: InChI=1S/C19H16BrN3O3/c1-26-18(24)11-16(13-6-3-2-4-7-13)23-19(25)14(12-21)10-15-8-5-9-17(20)22-15/h2-10,16H,11H2,1H3,(H,23,25)/b14-10+/t16-/m0/s1
Standard InChI Key: CQJCYXYDSUGERD-DKGMDFAASA-N
Molfile:
RDKit 2D
26 27 0 0 0 0 0 0 0 0999 V2000
9.3861 -15.8625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3849 -16.6898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0997 -17.1027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8162 -16.6894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8133 -15.8588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0979 -15.4497 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5262 -15.4436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2422 -15.8534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9552 -15.4383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2446 -16.6790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2477 -17.5040 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.6712 -15.8481 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9520 -14.6133 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3841 -15.4329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1001 -15.8427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1003 -16.6678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8155 -17.0775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5294 -16.6622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5236 -15.8330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8079 -15.4270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6715 -15.4501 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
14.3810 -14.6079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0939 -14.1927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0908 -13.3677 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.8099 -14.6025 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3748 -12.9579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9 13 2 0
1 2 2 0
12 14 1 0
5 7 1 0
14 15 1 0
3 4 2 0
15 16 2 0
7 8 2 0
16 17 1 0
17 18 2 0
8 9 1 0
18 19 1 0
4 5 1 0
19 20 2 0
20 15 1 0
2 3 1 0
1 21 1 0
10 11 3 0
14 22 1 1
8 10 1 0
22 23 1 0
5 6 2 0
23 24 1 0
9 12 1 0
23 25 2 0
6 1 1 0
24 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 414.26Molecular Weight (Monoisotopic): 413.0375AlogP: 3.17#Rotatable Bonds: 6Polar Surface Area: 92.08Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.72CX Basic pKa: 0.42CX LogP: 3.00CX LogD: 3.00Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.34Np Likeness Score: -1.04
References 1. Peng Z, Pal A, Han D, Wang S, Maxwell D, Levitzki A, Talpaz M, Donato NJ, Bornmann W.. (2011) Tyrphostin-like compounds with ubiquitin modulatory activity as possible therapeutic agents for multiple myeloma., 19 (23): [PMID:22036213 ] [10.1016/j.bmc.2011.09.057 ]