The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((3S)-1-(2-(7-acetyl-3,7-diazabicyclo[3.3.1]nonan-3-yl)-2-oxoethyl)-2-oxopiperidin-3-yl)-6-chloronaphthalene-2-sulfonamide ID: ALA1923469
PubChem CID: 57397646
Max Phase: Preclinical
Molecular Formula: C26H31ClN4O5S
Molecular Weight: 547.08
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)N1CC2CC(C1)CN(C(=O)CN1CCC[C@H](NS(=O)(=O)c3ccc4cc(Cl)ccc4c3)C1=O)C2
Standard InChI: InChI=1S/C26H31ClN4O5S/c1-17(32)30-12-18-9-19(13-30)15-31(14-18)25(33)16-29-8-2-3-24(26(29)34)28-37(35,36)23-7-5-20-10-22(27)6-4-21(20)11-23/h4-7,10-11,18-19,24,28H,2-3,8-9,12-16H2,1H3/t18?,19?,24-/m0/s1
Standard InChI Key: UWIZWPSBMKSPLR-MORLXBONSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
31.3993 -13.6533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1114 -14.0617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8236 -13.6533 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.8236 -12.8281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1114 -12.4113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9622 -12.4336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6772 -12.0216 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
26.0888 -11.3064 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.2636 -11.3076 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.1065 -11.1944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1065 -12.0196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8187 -12.4280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5309 -12.0196 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.5309 -11.1944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8187 -10.7776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8187 -13.2532 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.3924 -12.4332 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.2449 -12.4332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9604 -12.0212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6798 -12.4250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.9614 -11.1964 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.2528 -12.0181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2566 -13.6681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9680 -13.2544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5375 -13.2552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5399 -12.4334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8304 -12.0222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1181 -12.4317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1197 -13.2567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8297 -13.6642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4060 -13.6709 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
30.6845 -13.2503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1115 -13.2358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3831 -12.0020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5377 -14.0669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5365 -14.8921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2528 -13.6554 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18 19 1 0
8 7 2 0
19 20 1 0
7 9 2 0
19 21 2 0
1 2 1 0
6 22 2 0
22 26 1 0
2 3 1 0
25 23 1 0
10 15 1 0
23 24 2 0
24 6 1 0
11 12 1 0
12 13 1 0
25 26 1 0
13 14 1 0
26 27 2 0
14 15 1 0
27 28 1 0
3 4 1 0
28 29 2 0
12 16 2 0
29 30 1 0
30 25 2 0
10 11 1 0
29 31 1 0
20 32 1 0
11 17 1 1
17 7 1 0
7 6 1 0
20 34 1 0
32 1 1 0
1 33 1 0
33 5 1 0
5 34 1 0
4 5 1 0
3 35 1 0
13 18 1 0
35 36 1 0
35 37 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 547.08Molecular Weight (Monoisotopic): 546.1704AlogP: 2.09#Rotatable Bonds: 5Polar Surface Area: 107.10Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.04CX Basic pKa: ┄CX LogP: 0.50CX LogD: 0.49Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.62Np Likeness Score: -1.24
References 1. Shi Y, O'Connor SP, Sitkoff D, Zhang J, Shi M, Bisaha SN, Wang Y, Li C, Ruan Z, Lawrence RM, Klei HE, Kish K, Liu EC, Seiler SM, Schweizer L, Steinbacher TE, Schumacher WA, Robl JA, Macor JE, Atwal KS, Stein PD.. (2011) Arylsulfonamidopiperidone derivatives as a novel class of factor Xa inhibitors., 21 (24): [PMID:22041058 ] [10.1016/j.bmcl.2011.06.098 ]